|
|
| | 2,4-Dichloro-5-cyanopyrimidine Basic information |
| | 2,4-Dichloro-5-cyanopyrimidine Chemical Properties |
| Melting point | 62-63℃ | | Boiling point | 110-112 °C(Press: 2 Torr) | | density | 1.60±0.1 g/cm3 (20 ºC 760 Torr) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | -5.54±0.29(Predicted) | | Appearance | White to yellow Solid | | InChI | InChI=1S/C5HCl2N3/c6-4-3(1-8)2-9-5(7)10-4/h2H | | InChIKey | KMHSUNDEGHRBNV-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC=C(C#N)C(Cl)=N1 |
| Safety Statements | 24/25 | | RIDADR | UN3439 | | HS Code | 29335990 |
| | 2,4-Dichloro-5-cyanopyrimidine Usage And Synthesis |
| | 2,4-Dichloro-5-cyanopyrimidine Preparation Products And Raw materials |
|