|
|
| | 3-Methyl-2-nitrophenol Basic information |
| | 3-Methyl-2-nitrophenol Chemical Properties |
| Melting point | 35-39 °C (lit.) | | Boiling point | 106-108 °C/9.5 mmHg (lit.) | | density | 1.2744 (estimate) | | refractive index | 1.5744 (estimate) | | Fp | 225 °F | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Chloroform (Slightly), Dichloromethane, Methanol (Slightly) | | form | Solid | | pka | 7.00±0.10(Predicted) | | color | Light Yellow to Yellow | | BRN | 2047479 | | Henry's Law Constant | 3.2×100 mol/(m3Pa) at 25℃, Tremp et al. (1993) | | Stability: | Volatile | | InChI | InChI=1S/C7H7NO3/c1-5-3-2-4-6(9)7(5)8(10)11/h2-4,9H,1H3 | | InChIKey | QIORDSKCCHRSSD-UHFFFAOYSA-N | | SMILES | C1(O)=CC=CC(C)=C1[N+]([O-])=O | | CAS DataBase Reference | 4920-77-8(CAS DataBase Reference) | | NIST Chemistry Reference | 3-Methyl-2-nitrophenol(4920-77-8) |
| Hazard Codes | Xn,Xi | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-36/37-37/39-36 | | RIDADR | UN 2446 6.1/PG III (NITROCRESOLS, SOLID) | | RIDADR | UN 3434 6.1/PG III (NITROCRESOLS, LIQUID) | | WGK Germany | 3 | | F | 10 | | Hazard Note | Harmful/Irritant | | HazardClass | 6.1(b) | | PackingGroup | III | | HS Code | 29071990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3-Methyl-2-nitrophenol Usage And Synthesis |
| Chemical Properties | Yellow Solid | | Uses | A nitrophenol derivative as antitumor agent. | | Uses | 3-Methyl-2-nitrophenol was used to investigate the formation of nitrous acid (HONO) in the gas phase in a flow tube photoreactor upon irradiation of ortho-nitrophenols. | | General Description | 3-Methyl-2-nitrophenol is also referred as 3-methyl-2-nitro-1-hydroxybenzene. FT-IR and FT-Raman spectra of 3-methyl-2-nitrophenol has been studied. |
| | 3-Methyl-2-nitrophenol Preparation Products And Raw materials |
|