|
|
| | D-Galactono-1,4-lactone Basic information |
| Product Name: | D-Galactono-1,4-lactone | | Synonyms: | 1,4-D-Galactonolactone;Galactonic acid, gamma-lactone, D-;GALACTONO-1,4-LACTONE, D-;GAMMA-D-GALACTONOLACTONE;D(-)-GALACTONIC ACID GAMMA-LACTONE;D(-)-GALACTONO-GAMMA-LACTONE;D-GALACTONO-GAMMA-LACTONE;D-GALACTONO-G-LACTONE | | CAS: | 2782-07-2 | | MF: | C6H10O6 | | MW: | 178.14 | | EINECS: | 220-484-9 | | Product Categories: | | | Mol File: | 2782-07-2.mol |  |
| | D-Galactono-1,4-lactone Chemical Properties |
| Melting point | 137°C | | Boiling point | 467.9±18.0 °C(Predicted) | | density | 1.766±0.06 g/cm3(Predicted) | | solubility | DMSO (Slightly), Water (Slightly) | | form | Solid | | pka | 12.06±0.60(Predicted) | | color | White to Off-White | | Cosmetics Ingredients Functions | HUMECTANT | | InChI | InChI=1/C6H10O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2-5,7-10H,1H2/t2-,3-,4-,5+/s3 | | InChIKey | SXZYCXMUPBBULW-IWTJONABNA-N | | SMILES | [C@@H]1([C@H](O)CO)OC(=O)[C@H](O)[C@H]1O |&1:0,1,8,10,r| | | LogP | -3.400 (est) | | CAS DataBase Reference | 2782-07-2(CAS DataBase Reference) | | EPA Substance Registry System | D-Galactonic acid, .gamma.-lactone (2782-07-2) |
| Safety Statements | 22-24/25 | | TSCA | TSCA listed | | HS Code | 29322090 |
| | D-Galactono-1,4-lactone Usage And Synthesis |
| Uses | D-Galactono-1,4-lactone was used in carbohydrate research as an elution compound for the purification process of exo-β-D-galactofuranosidase enzyme. | | Definition | ChEBI: A galactonolactone derived from D-galactonic acid. | | Purification Methods | Crystallise the lactone from EtOH, aqueous EtOH, MeOH or EtOAc. It is also purified by passage through a column of Amberlite IR-120 (H+ form), and the effluent and washings are then freeze-dried [Wolfrom & Thompson Methods in Carbohydrate Chemistry I 67 1963, Academic Press]. The 5,6-O-isopropylidene-D-galactono-1,4-lactone is purified by chromatography (EtOAc) and has m 165-167o (from EtOH/hexane), and 167.5-168.5o (from Me2CO/*C6H6) [NMR: Copel & Stick Aust J Chem 31 1371 1978.] [Beilstein 18 III/IV 3026, 18/5 V 18.] |
| | D-Galactono-1,4-lactone Preparation Products And Raw materials |
|