| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
GSK-CXCR2 manufacturers
- SB-265610
-
- $51.00
-
2026-07-27
- CAS:211096-49-0
- Purity: 99.50%
- Supply Ability: 10g
|
| | GSK-CXCR2 Basic information |
| Product Name: | GSK-CXCR2 | | Synonyms: | GSK-CXCR2;N-(2-Bromophenyl)-N'-(7-cyano-1H-benzotriazol-4-yl)urea;SB 265610;1-(2-Bromophenyl)-3-(4-cyano-1H-benzo[d] [1,2,3]triazol-7-yl)urea;Urea, N-(2-bromophenyl)-N'-(4-cyano-1H-benzotriazol-7-yl)-;SB265610 >=98% (HPLC);CXCR,nonpeptide,inhibit,Inhibitor,SB-265610,inflammation,recruitment,Delay,SB 265610,healing,neutrophil,SB265610,wound,CXC chemokine receptors;SB-265610, 10 mM in DMSO | | CAS: | 211096-49-0 | | MF: | C14H9BrN6O | | MW: | 357.16 | | EINECS: | | | Product Categories: | | | Mol File: | 211096-49-0.mol |  |
| | GSK-CXCR2 Chemical Properties |
| Boiling point | 527.0±45.0 °C(Predicted) | | density | 1.77±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: soluble15mg/mL, clear | | form | powder | | pka | 6.13±0.40(Predicted) | | color | white to light brown | | InChI | 1S/C14H9BrN6O/c15-9-3-1-2-4-10(9)17-14(22)18-11-6-5-8(7-16)12-13(11)20-21-19-12/h1-6H,(H2,17,18,22)(H,19,20,21) | | InChIKey | SEDUMQWZEOMXSO-UHFFFAOYSA-N | | SMILES | Brc1ccccc1NC(=O)Nc2ccc(C#N)c3nn[nH]c23 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | GSK-CXCR2 Usage And Synthesis |
| Uses | SB 265610 is an anti-tumor pharmaceutical developed to act as an antagonist to cysteine-amino acid-cysteine (CXC) chemokines receptor 2 antagonist. | | Biological Activity | Potent CXCR2 antagonist that inhibits CINC-1-mediated but not C5a-mediated Ca 2+ mobilization (IC 50 values are 3.4 and 6800 nM respectively). Inhibits CINC-induced chemotaxis and attenuates neutrophil accumulation in inflammatory lung injury in vivo . | | Biochem/physiol Actions | SB265610 is a potent and selective CXCR2 chemokine receptor antagonist. It has a Kd = 2.5 nM. | | in vivo | SB-265610 (2 mg/kg/day; i.p.; daily; for two weeks) treatment significantly inhibits the recruitment of Gr-1+CD11b+ cells to the mammary adenocarcinoma with Tgfbr2 deletion but not the control tumors[3]. | Animal Model: | MMTV-PyVmT/Tgfbr2MGKO and MMTV-PyVmT/Tgfbr2flox/flox tumors from donor mice[3] | | Dosage: | 2 mg/kg/day
| | Administration: | Intraperitoneal injection; daily; for two weeks | | Result: | Significantly inhibited the recruitment of Gr-1+CD11b+ cells to the mammary adenocarcinoma. |
| | IC 50 | CXCR2 | | storage | Store at RT |
| | GSK-CXCR2 Preparation Products And Raw materials |
|