| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 7-Chloro-2,8-dimethyl-4-quinolinol Basic information |
| Product Name: | 7-Chloro-2,8-dimethyl-4-quinolinol | | Synonyms: | AURORA 19734;7-CHLORO-2,8-DIMETHYL-4-HYDROXYQUINOLINE;7-CHLORO-2,8-DIMETHYLQUINOLIN-4-OL;7-chloro-2,8-dimethyl-1H-quinolin-4-one;4-Quinolinol, 7-chloro-2,8-dimethyl-;7-Chloro-2,8-dimethyl-4-quinolinol | | CAS: | 21629-48-1 | | MF: | C11H10ClNO | | MW: | 207.66 | | EINECS: | | | Product Categories: | | | Mol File: | 21629-48-1.mol |  |
| | 7-Chloro-2,8-dimethyl-4-quinolinol Chemical Properties |
| form | solid | | InChI | 1S/C11H10ClNO/c1-6-5-10(14)8-3-4-9(12)7(2)11(8)13-6/h3-5H,1-2H3,(H,13,14) | | InChIKey | LOJPYUFGOCWEHF-UHFFFAOYSA-N | | SMILES | Cc1cc(O)c2ccc(Cl)c(C)c2n1 |
| Hazard Codes | Xi,T | | Risk Statements | 25-41 | | Safety Statements | 26-39-45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | Hazard Note | Irritant | | Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 |
| | 7-Chloro-2,8-dimethyl-4-quinolinol Usage And Synthesis |
| | 7-Chloro-2,8-dimethyl-4-quinolinol Preparation Products And Raw materials |
|