| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 7-Chloro-4-hydroxy-8-methylquinoline Basic information |
| | 7-Chloro-4-hydroxy-8-methylquinoline Chemical Properties |
| Melting point | 317 °C | | Boiling point | 360.6±37.0 °C(Predicted) | | density | 1.350±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | powder | | pka | 4.03±0.40(Predicted) | | color | Light brown | | InChI | 1S/C10H8ClNO/c1-6-8(11)3-2-7-9(13)4-5-12-10(6)7/h2-5H,1H3,(H,12,13) | | InChIKey | SFEXKUDRCXAASW-UHFFFAOYSA-N | | SMILES | CC1=C(C=CC2=C(C=CN=C12)O)Cl |
| Hazard Codes | Xn | | Risk Statements | 22-41 | | Safety Statements | 26-39 | | WGK Germany | WGK 3 | | HS Code | 2933499090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
| | 7-Chloro-4-hydroxy-8-methylquinoline Usage And Synthesis |
| | 7-Chloro-4-hydroxy-8-methylquinoline Preparation Products And Raw materials |
|