| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
- 7-Chloroquinolin-4-ol
-
- $1.10
-
2026-08-20
- CAS:86-99-7
- Min. Order: 1g
- Purity: 99.00%
- Supply Ability: 100 Tons
|
| | 7-Chloroquinolin-4-ol Basic information |
| | 7-Chloroquinolin-4-ol Chemical Properties |
| Melting point | 276-279 °C(lit.) | | Boiling point | 348.5±22.0 °C(Predicted) | | density | 1.412±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 3.86±0.40(Predicted) | | Appearance | Off-white to light brown Solid | | BRN | 125356 | | InChI | InChI=1S/C9H6ClNO/c10-6-1-2-7-8(5-6)11-4-3-9(7)12/h1-5H,(H,11,12) | | InChIKey | XMFXTXKSWIDMER-UHFFFAOYSA-N | | SMILES | N1C2C(=CC=C(Cl)C=2)C(O)=CC=1 | | CAS DataBase Reference | 86-99-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HS Code | 2933499090 |
| | 7-Chloroquinolin-4-ol Usage And Synthesis |
| Uses | 7-Chloroquinolin-4-ol is a pharmaceutical and dye intermediate that can be used to synthesize the anti-cancer drug chloroquine phosphate. |
| | 7-Chloroquinolin-4-ol Preparation Products And Raw materials |
|