| Company Name: |
Ark Pharm, Inc. |
| Tel: |
847-367-3680 |
| Email: |
sales@arkpharminc.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- 1-Phenyloxindole
-
- $1.00
-
2024-07-11
- CAS:3335-98-6
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20T
- 1-Phenyloxindole
-
- $15.00
-
2021-08-13
- CAS:3335-98-6
- Min. Order: 1g
- Purity: 99
- Supply Ability: 50ton
- 1-Phenyloxindole
-
- $7.00
-
2020-02-17
- CAS:3335-98-6
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 100KG
|
| | 1-Phenyloxindole Basic information |
| | 1-Phenyloxindole Chemical Properties |
| Melting point | 123-125 | | Boiling point | 443.6±25.0 °C(Predicted) | | density | 1.228±0.06 g/cm3(Predicted) | | vapor pressure | 0.002Pa at 20℃ | | storage temp. | Sealed in dry,Room Temperature | | solubility | Practically insoluble in water | | form | powder to crystal | | pka | -3.41±0.20(Predicted) | | color | White to Light yellow | | Water Solubility | 74.3mg/L at 20℃ | | InChI | InChI=1S/C14H11NO/c16-14-10-11-6-4-5-9-13(11)15(14)12-7-2-1-3-8-12/h1-9H,10H2 | | InChIKey | OWPNVXATCSXTBK-UHFFFAOYSA-N | | SMILES | N1(C2=CC=CC=C2)C2=C(C=CC=C2)CC1=O | | LogP | 2.6 at 26℃ | | CAS DataBase Reference | 3335-98-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | HazardClass | IRRITANT | | HS Code | 2933790090 |
| | 1-Phenyloxindole Usage And Synthesis |
| Uses | 1-Phenyloxindole can be used as a major intermediate in the drug linopyridine. | | Flammability and Explosibility | Non flammable |
| | 1-Phenyloxindole Preparation Products And Raw materials |
|