| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- 1-PHENYLISATIN
-
- $1.00
-
2020-01-09
- CAS:723-89-7
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 100KG
|
| | 1-Phenylisatin Basic information |
| | 1-Phenylisatin Chemical Properties |
| Melting point | 138-140 °C (lit.) | | Boiling point | 388.8±25.0 °C(Predicted) | | density | 1.338±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | -7.03±0.20(Predicted) | | form | powder to crystal | | color | Light yellow to Brown | | Water Solubility | Insoluble in water. | | λmax | 419nm(EtOH)(lit.) | | BRN | 164531 | | InChI | InChI=1S/C14H9NO2/c16-13-11-8-4-5-9-12(11)15(14(13)17)10-6-2-1-3-7-10/h1-9H | | InChIKey | UWCPWBIMRYXUOU-UHFFFAOYSA-N | | SMILES | N1(C2=CC=CC=C2)C2=C(C=CC=C2)C(=O)C1=O | | CAS DataBase Reference | 723-89-7(CAS DataBase Reference) |
| Hazard Codes | T | | Risk Statements | 23/24/25 | | Safety Statements | 27-28-36/37/39-45 | | WGK Germany | 3 | | RTECS | NL7984000 | | HazardClass | IRRITANT | | HS Code | 29337900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 1-Phenylisatin Usage And Synthesis |
| Uses | 1-Phenylisatin is a reactant for preparation of indolin-2,3-dione Schiff bases as potential antimycobacterial agents, antipyretic agents, antiproliferative agents, phenylacetamides as anticonvulsant agents and selective Galanin GAL3 receptor antagonists. | | General Description | 1-Phenylisatin is an isatin. It is a potential anticancer, anti-HIV drug. Its binding interaction with a model transport protein bovine serum albumin (BSA) has been investigated using fluorescence spectroscopic technique. Interactions between human adult hemoglobin (Hb) and 1-phenylisatin has been investigated by steady state and time-resolved fluorescence along with circular dichroism (CD) spectroscopic, FTIR and anisotropy. |
| | 1-Phenylisatin Preparation Products And Raw materials |
|