|
|
| | 5-BROMO-2,3-DIFLUOROPYRIDINE Basic information |
| | 5-BROMO-2,3-DIFLUOROPYRIDINE Chemical Properties |
| Boiling point | 175 °C | | density | 1.808±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | form | Liquid | | pka | -5.21±0.20(Predicted) | | color | Colorless to pale yellow | | Water Solubility | Slightly soluble in water. | | InChI | InChI=1S/C5H2BrF2N/c6-3-1-4(7)5(8)9-2-3/h1-2H | | InChIKey | QVIQXJRQVOPYGI-UHFFFAOYSA-N | | SMILES | C1(F)=NC=C(Br)C=C1F |
| Hazard Codes | Xn | | Risk Statements | 22-37/38-41 | | Safety Statements | 26-39 | | HazardClass | IRRITANT | | HS Code | 2933599590 |
| | 5-BROMO-2,3-DIFLUOROPYRIDINE Usage And Synthesis |
| Uses | It is an important raw material and intermediate used in organic synthesis agrochemical, pharmaceutical and dyestuff field. |
| | 5-BROMO-2,3-DIFLUOROPYRIDINE Preparation Products And Raw materials |
|