|
|
| | 2-(4-Bromophenyl)ethylamine Basic information |
| | 2-(4-Bromophenyl)ethylamine Chemical Properties |
| Boiling point | 63-72 °C/0.2 mmHg (lit.) | | density | 1.29 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.574(lit.) | | Fp | >230 °F | | storage temp. | Refrigerator, under inert atmosphere | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | pka | 9.72±0.10(Predicted) | | form | Liquid | | Specific Gravity | 1.290 | | color | Colorless | | Water Solubility | Slightly soluble in water. | | InChI | InChI=1S/C8H10BrN/c9-8-3-1-7(2-4-8)5-6-10/h1-4H,5-6,10H2 | | InChIKey | ZSZCXAOQVBEPME-UHFFFAOYSA-N | | SMILES | C1(CCN)=CC=C(Br)C=C1 | | CAS DataBase Reference | 73918-56-6(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-27-36/37/39-45 | | RIDADR | UN 2735 8/PG 2 | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29214990 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Skin Corr. 1B |
| | 2-(4-Bromophenyl)ethylamine Usage And Synthesis |
| Chemical Properties | CLEAR COLOURLESS TO YELLOW LIQUID | | Uses | 4-Bromophenethylamine was used in the synthesis of pyrazinoisoquinoline derivatives and N-2-(4-bromophenyl)ethyl chloroacetamide. It was also used in the synthesis of alkyl arylamino sufides employing elemental sulfur and various halides. | | Uses | 4-Bromophenethylamine was used in the synthesis of pyrazinoisoquinoline derivatives and N-2-(4-bromophenyl)ethyl chloroacetamide. It was also used in the synthesis of alkyl arylamino sufides employing elemental sulfur and various halides. |
| | 2-(4-Bromophenyl)ethylamine Preparation Products And Raw materials |
|