| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | beta-D-Glucosamine pentaacetate Basic information |
| Product Name: | beta-D-Glucosamine pentaacetate | | Synonyms: | PENTAACETYL-BETA-D-GLUCOSAMINE;2-(Acetylamino)-2-deoxy-β-D-glucopyranose 1,3,4,6-tetraacetate;2-(Acetylamino)-2-deoxy-β-D-glucopyranose tetraacetate;2-Acetamido-2-deoxy-1,3,4,6-tetra-O-acetyl-beta-D-glucopyranose,96%;2-Acetamido-1,3,4,6-tetra-O-acetyl-2-deoxy-β-D-glucopyranose ,98%;1,3,4,6-Tetra-O-acetyl-N-acetyl-β-D-glucosamine;2-(acetylaMino)-2-deoxy- b-D-Glucopyranose 1,3,4,6-tetraacetate;NSC 224432 | | CAS: | 7772-79-4 | | MF: | C16H23NO10 | | MW: | 389.35 | | EINECS: | 231-865-4 | | Product Categories: | substrate;Carbohydrates & Derivatives;Aminosugars;Biochemistry;Glucose;Sugars;Sugars, Carbohydrates & Glucosides;Glycon Biochem | | Mol File: | 7772-79-4.mol |  |
| | beta-D-Glucosamine pentaacetate Chemical Properties |
| Melting point | 186-189 °C(lit.) | | Boiling point | 530.2±50.0 °C(Predicted) | | density | 1.30±0.1 g/cm3(Predicted) | | refractive index | 2 ° (C=5, CHCl3) | | storage temp. | Sealed in dry,2-8°C | | solubility | Chloroform (Slightly, Heated, Sonicated), Methanol (Slightly, Heated, Sonicated) | | pka | 13.41±0.70(Predicted) | | form | Solid | | color | White to Light Brown | | Optical Rotation | [α]24/D +1.7 to +3.0°, c = 10 in chloroform | | BRN | 98835 | | InChI | 1S/C16H23NO10/c1-7(18)17-13-15(25-10(4)21)14(24-9(3)20)12(6-23-8(2)19)27-16(13)26-11(5)22/h12-16H,6H2,1-5H3,(H,17,18)/t12-,13-,14-,15-,16-/m1/s1 | | InChIKey | OVPIZHVSWNOZMN-OXGONZEZSA-N | | SMILES | CC(=O)N[C@H]1[C@@H](O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O)OC(C)=O | | CAS DataBase Reference | 7772-79-4(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29329990 | | Storage Class | 11 - Combustible Solids |
| | beta-D-Glucosamine pentaacetate Usage And Synthesis |
| Chemical Properties | white powder | | Uses | An N-acetylglucosamine derivatives as promoters for hyaluronic acid production. | | Uses | β-D-Glucosamine Pentaacetate is an N-acetylglucosamine derivative that has been shown to promote hyaluronic acid production. |
| | beta-D-Glucosamine pentaacetate Preparation Products And Raw materials |
|