|
|
| | Diethyl succinate-2,2,3,3-d4 Basic information |
| Product Name: | Diethyl succinate-2,2,3,3-d4 | | Synonyms: | DIETHYL SUCCINATE-D4;DIETHYL SUCCINATE-2,2,3,3-D4, 98 ATOM % D;Butanedioic-d4 acid, diethyl ester;diethyl butanedioate-2,2,3,3-d4;Diethyl succinate-2,2,3,3-d4;Diethyl succinate-2,2,3,3-d4 | | CAS: | 52089-62-0 | | MF: | C8H10D4O4 | | MW: | 178.22 | | EINECS: | | | Product Categories: | | | Mol File: | 52089-62-0.mol |  |
| | Diethyl succinate-2,2,3,3-d4 Chemical Properties |
| Melting point | -20 °C(lit.) | | Boiling point | 218 °C(lit.) | | density | 1.050 g/mL at 25 °C | | refractive index | n20/D 1.419(lit.) | | Fp | 212 °F | | InChI | 1S/C8H14O4/c1-3-11-7(9)5-6-8(10)12-4-2/h3-6H2,1-2H3/i5D2,6D2 | | InChIKey | DKMROQRQHGEIOW-NZLXMSDQSA-N | | SMILES | [2H]C([2H])(C(=O)OCC)C([2H])([2H])C(=O)OCC |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids |
| | Diethyl succinate-2,2,3,3-d4 Usage And Synthesis |
| Uses | Diethyl Succinate-d4 (CAS# 52089-62-0) is a useful isotopically labeled research compound. |
| | Diethyl succinate-2,2,3,3-d4 Preparation Products And Raw materials |
|