|
|
| | 2-Iodo-3-methylpyridine Basic information |
| | 2-Iodo-3-methylpyridine Chemical Properties |
| Boiling point | 80°C/0.3mm | | density | 1.827 g/mL at 25 °C | | refractive index | 1.625 | | Fp | >110℃ | | storage temp. | 2-8°C | | pka | 2.14±0.10(Predicted) | | form | liquid | | Appearance | Colorless to light yellow Liquid | | Sensitive | Light Sensitive | | BRN | 5328169 | | InChI | InChI=1S/C6H6IN/c1-5-3-2-4-8-6(5)7/h2-4H,1H3 | | InChIKey | PTBOOHAPESUXGV-UHFFFAOYSA-N | | SMILES | C1(I)=NC=CC=C1C | | CAS DataBase Reference | 22282-58-2(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 20/21/22-36/37/38-41-37/38-22 | | Safety Statements | 26-36/37/39-39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29333990 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Dam. 1
Skin Irrit. 2
STOT SE 3 |
| Provider | Language |
|
ALFA
| English |
| | 2-Iodo-3-methylpyridine Usage And Synthesis |
| Uses | 2-Iodo-3-methylpyridine is a heterocyclic organic compound and can be used as an intermediate in pharmaceutical synthesis. |
| | 2-Iodo-3-methylpyridine Preparation Products And Raw materials |
|