|
|
| | PYRIDINE, 4,4'-[1,1'-BIPHENYL]-4,4'-DIYLBIS- Basic information |
| Product Name: | PYRIDINE, 4,4'-[1,1'-BIPHENYL]-4,4'-DIYLBIS- | | Synonyms: | 4,4'-Bis(4-pyridyl)biphenyl;4,4'-(4,4'-Biphenyldiyl)dipyridine;4,4,-di(pyridin-4-yl)-1,1,-biphenyl;4,4'-Di(4-pyridyl)biphenyl >4-[4-(4-Pyridin-4-ylphenyl)phenyl]pyridine;DK7542;Pyridine, 4,4'-[1,1'-Biphenyl]-4,4'-Diylbis-;4,4'-Bis(4-pyridyl)biphenyl | | CAS: | 319430-87-0 | | MF: | C22H16N2 | | MW: | 308.38 | | EINECS: | | | Product Categories: | | | Mol File: | 319430-87-0.mol | ![PYRIDINE, 4,4'-[1,1'-BIPHENYL]-4,4'-DIYLBIS- Structure](CAS/GIF/319430-87-0.gif) |
| | PYRIDINE, 4,4'-[1,1'-BIPHENYL]-4,4'-DIYLBIS- Chemical Properties |
| Melting point | 308°C(lit.) | | Boiling point | 533.0±35.0 °C(Predicted) | | density | 1.134±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 5.63±0.10(Predicted) | | form | powder to crystal | | color | White to Yellow to Orange | | InChI | InChI=1S/C22H16N2/c1-5-19(21-9-13-23-14-10-21)6-2-17(1)18-3-7-20(8-4-18)22-11-15-24-16-12-22/h1-16H | | InChIKey | RERPRBPQDPHWCZ-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(C3C=CN=CC=3)C=C2)=CC=C(C2C=CN=CC=2)C=C1 |
| | PYRIDINE, 4,4'-[1,1'-BIPHENYL]-4,4'-DIYLBIS- Usage And Synthesis |
| | PYRIDINE, 4,4'-[1,1'-BIPHENYL]-4,4'-DIYLBIS- Preparation Products And Raw materials |
|