|
|
| | N'-formyl-L-Kynurenine Basic information |
| Product Name: | N'-formyl-L-Kynurenine | | Synonyms: | Benzenebutanoic acid, a-aMino-2-(forMylaMino)-g-oxo-, (aS)-;￥759,287.00;Formyl-L-Kynurenine;Tryptophan EP Impurity E;Tryptophan Impurity 8（Tryptophan EP Impurity E）;(S)-2-Amino-4-(2-formamidophenyl)-4-oxobutanoic acid;Benzenebutanoic acid, α-amino-2-(formylamino)-γ-oxo-, (αS)-;(2S)-2-amino-4-(2-formamidophenyl)-4-oxobutanoicaci | | CAS: | 3978-11-8 | | MF: | C11H12N2O4 | | MW: | 236.22 | | EINECS: | | | Product Categories: | | | Mol File: | 3978-11-8.mol |  |
| | N'-formyl-L-Kynurenine Chemical Properties |
| Melting point | 162 °C (decomp) | | Boiling point | 563.4±50.0 °C(Predicted) | | density | 1.394±0.06 g/cm3(Predicted) | | pka | 2.17±0.23(Predicted) | | form | solid | | Major Application | pharmaceutical small molecule | | InChI | InChI=1/C11H12N2O4/c12-8(11(16)17)5-10(15)7-3-1-2-4-9(7)13-6-14/h1-4,6,8H,5,12H2,(H,13,14)(H,16,17)/t8-/s3 | | InChIKey | BYHJHXPTQMMKCA-SBYBRXNCNA-N | | SMILES | C(O)(=O)[C@@H](N)CC(C1=CC=CC=C1NC=O)=O |&1:3,r| |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | N'-formyl-L-Kynurenine Usage And Synthesis |
| Uses | Formylkynurenine is the impurity of Tryptophan (T947210), which is an essential amino acid. | | Definition | ChEBI: N-formyl-L-kynurenine is a N-formylkynurenine, a non-proteinogenic L-alpha-amino acid and a non-proteinogenic amino acid derivative. It has a role as a human metabolite, a Saccharomyces cerevisiae metabolite and a mouse metabolite. It is functionally related to a L-kynurenine. It is a tautomer of a N-formyl-L-kynurenine zwitterion. |
| | N'-formyl-L-Kynurenine Preparation Products And Raw materials |
|