| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- Afatinib impurity B
-
-
2026-03-12
- CAS:314771-76-1
- Min. Order: 10mg
- Purity: 98%
- Supply Ability: 500mg
|
| | (S)-N4-(3-chloro-4-fluorophenyl)-7-(tetrahydrofuran-3-yloxy)quinazoline-4,6-diaMine Basic information |
| Product Name: | (S)-N4-(3-chloro-4-fluorophenyl)-7-(tetrahydrofuran-3-yloxy)quinazoline-4,6-diaMine | | Synonyms: | 4-QuinazolinaMine, N-(3-chloro-4-fluorophenyl)-6-amine-7-[[(3S)-tetrahydro-3-furanyl]oxy]-;6-Amino-4-[(3-chloro-4-fluorophenyl)amino]-7-[[(S)-tetrahydro-3-furanyl]oxy]quinazoline;Afatinib-1;(S)-N4-(3-chloro-4-fluorophenyl)-7-(tetrahydrofuran-3-yloxy)quinazoline-4,6-diammine;4,6-Quinazolinediamine, N4-(3-chloro-4-fluorophenyl)-7-[[(3S)-tetrahydro-3-furanyl]oxy]-;Afatinib-des(4-dimethylamino-2-en-1-oxo)butyl;N4-(3-Chloro-4-fluorophenyl)-7-[[(3S)-tetrahydro-3-furanyl]oxy]-4,6-quinazolinediamine;Intermediates of sunitinib | | CAS: | 314771-76-1 | | MF: | C18H16ClFN4O2 | | MW: | 374.8 | | EINECS: | 1312995-182-4 | | Product Categories: | Afatinib Dimaleate;314771-76-1 | | Mol File: | 314771-76-1.mol |  |
| | (S)-N4-(3-chloro-4-fluorophenyl)-7-(tetrahydrofuran-3-yloxy)quinazoline-4,6-diaMine Chemical Properties |
| Boiling point | 559.0±50.0 °C(Predicted) | | density | 1.473±0.06 g/cm3 (20 ºC 760 Torr) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | DMSO (Slightly), Methanol (Slightly, Sonicated, Heated) | | pka | 5.89±0.30(Predicted) | | form | Solid | | color | Light Yellow to Light Beige | | Optical Rotation | Consistent with structure | | InChI | InChI=1S/C18H16ClFN4O2/c19-13-5-10(1-2-14(13)20)24-18-12-6-15(21)17(7-16(12)22-9-23-18)26-11-3-4-25-8-11/h1-2,5-7,9,11H,3-4,8,21H2,(H,22,23,24)/t11-/m0/s1 | | InChIKey | BIQABKFYKJRXII-NSHDSACASA-N | | SMILES | N1=C2C(C=C(N)C(O[C@H]3CCOC3)=C2)=C(NC2=CC=C(F)C(Cl)=C2)N=C1 |
| | (S)-N4-(3-chloro-4-fluorophenyl)-7-(tetrahydrofuran-3-yloxy)quinazoline-4,6-diaMine Usage And Synthesis |
| Uses | (S)-N4-(3-chloro-4-fluorophenyl)-7-(tetrahydrofuran-3-yloxy)quinazoline-4,6-diamine can be used as organic synthesis intermediate and pharmaceutical intermediate, mainly used in laboratory research and development process and chemical production process. | | Synthesis | To a solution of 4-(3-chloro-4-fluorophenyl)amino-6-nitro-7-[[(S)-tetrahydro-3-furanyl]oxy]-
quinazoline (1.34 g, 3.31 mmol) and ammonium chloride (496 mg, 9.27 mmol)
in anhydrous DMF (22 mL), Raney nickel [1.5 mL, 50 % (w/v) in water] was added to
the reaction mixture and stirred under an atmosphere of hydrogen at 40 °C for 2 h. After
2 h the reaction was diluted with EtOH (10 mL), filtered through diatomaceous earth
and washed with a large excess of EtOH. The residue was concentrated under reduced
pressure and purified by column chromatography eluting with CHCl3/MeOH (95:5) to
give 6 as a viscous brown oil (950 mg, 77 %). |
| | (S)-N4-(3-chloro-4-fluorophenyl)-7-(tetrahydrofuran-3-yloxy)quinazoline-4,6-diaMine Preparation Products And Raw materials |
|