N-tert-butyl-L-serineisopropyl ester manufacturers
|
| | N-tert-butyl-L-serineisopropyl ester Basic information |
| Product Name: | N-tert-butyl-L-serineisopropyl ester | | Synonyms: | N-tert-butyl-L-serineisopropyl ester;(S)-Isopropyl 2-((tert-butoxycarbonyl)amino)-3-hydroxypropanoate;N-tert-butoxycarbonylserine isopropyl ester;Serine, N-[(1,1-dimethylethoxy)carbonyl]-, 1-methylethyl ester;N-tert-butyl-serineisopropyl ester;Isopropyl (tert-butoxycarbonyl)serinate;tert-butyl-L-Serineisopropyl ester;boc-dl-ser-oipr | | CAS: | 955379-18-7 | | MF: | C11H21NO5 | | MW: | 247.29 | | EINECS: | | | Product Categories: | | | Mol File: | 955379-18-7.mol |  |
| | N-tert-butyl-L-serineisopropyl ester Chemical Properties |
| Boiling point | 374.2±32.0 °C(Predicted) | | density | 1.103±0.06 g/cm3(Predicted) | | pka | 10.83±0.46(Predicted) | | InChI | InChI=1S/C11H21NO5/c1-7(2)16-9(14)8(6-13)12-10(15)17-11(3,4)5/h7-8,13H,6H2,1-5H3,(H,12,15)/t8-/m0/s1 | | InChIKey | QVURMCPIMAXTNA-QMMMGPOBSA-N | | SMILES | C(OC(C)C)(=O)[C@H](CO)NC(OC(C)(C)C)=O |
| | N-tert-butyl-L-serineisopropyl ester Usage And Synthesis |
| | N-tert-butyl-L-serineisopropyl ester Preparation Products And Raw materials |
|