| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | N-Boc-cyclohexamide Basic information |
| Product Name: | N-Boc-cyclohexamide | | Synonyms: | N-Boc-ε-caprolactaM;1H-Azepine-1-carboxylic acid, hexahydro-2-oxo-, 1,1-dimethylethyl ester;N-Boc-epsilon-caprolactam;1-Boc-2-oxoazepane;N-Boc-ε-caprolactam;1-Boc-azepan-2-one;N-Boc-cyclohexamide | | CAS: | 106412-36-6 | | MF: | C11H19NO3 | | MW: | 213.27 | | EINECS: | | | Product Categories: | | | Mol File: | 106412-36-6.mol |  |
| | N-Boc-cyclohexamide Chemical Properties |
| Melting point | 35-37 °C | | Boiling point | 120 °C(Press: 0.03 Torr) | | density | 1.038 g/mL at 25 °C | | refractive index | n20/D1.468 | | Fp | >110℃ | | storage temp. | Sealed in dry,Room Temperature | | form | liquid | | pka | -2.29±0.20(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | 1S/C11H19NO3/c1-11(2,3)15-10(14)12-8-6-4-5-7-9(12)13/h4-8H2,1-3H3 | | InChIKey | GJZYNYJIBDCRFC-UHFFFAOYSA-N | | SMILES | CC(C)(C)OC(=O)N1CCCCCC1=O |
| Hazard Codes | Xi,N | | Risk Statements | 36/37/38-50 | | Safety Statements | 26-61 | | RIDADR | UN 3082 9 / PGIII | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Aquatic Acute 1 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | N-Boc-cyclohexamide Usage And Synthesis |
| | N-Boc-cyclohexamide Preparation Products And Raw materials |
|