|
|
| | N-Ethylbenzamide Basic information |
| Product Name: | N-Ethylbenzamide | | Synonyms: | n-ethyl-benzamid;LABOTEST-BB LT00790839;Benzamide, N-ethyl- (6CI,7CI,8CI,9CI);NSC 20558;Benzamide, N-ethyl-;N-Ethylbenamide;N-Ethylbenzamide | | CAS: | 614-17-5 | | MF: | C9H11NO | | MW: | 149.19 | | EINECS: | | | Product Categories: | AMIDE | | Mol File: | 614-17-5.mol |  |
| | N-Ethylbenzamide Chemical Properties |
| Melting point | 70.5°C | | Boiling point | 317℃ | | density | 1.019 | | refractive index | 1.5279 (estimate) | | Fp | 184℃ | | pka | 15.01±0.46(Predicted) | | InChI | InChI=1S/C9H11NO/c1-2-10-9(11)8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,10,11) | | InChIKey | SDIDYFBTIZOPLA-UHFFFAOYSA-N | | SMILES | C(NCC)(=O)C1=CC=CC=C1 |
| | N-Ethylbenzamide Usage And Synthesis |
| | N-Ethylbenzamide Preparation Products And Raw materials |
|