| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | Isonicotinoyl chloride hydrochloride Basic information | | Uses |
| | Isonicotinoyl chloride hydrochloride Chemical Properties |
| Melting point | 159-161 °C(lit.) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | methanol: soluble50mg/mL, clear to hazy, colorless to light yellow | | form | Crystalline Powder | | color | Almost white to beige | | Water Solubility | almost transparency | | Sensitive | Moisture Sensitive | | BRN | 3626052 | | InChI | InChI=1S/C6H4ClNO.ClH/c7-6(9)5-1-3-8-4-2-5;/h1-4H;1H | | InChIKey | BNTRVUUJBGBGLZ-UHFFFAOYSA-N | | SMILES | C1(C(Cl)=O)=CC=NC=C1.Cl | | CAS DataBase Reference | 39178-35-3(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | Hazard Note | Corrosive | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29333990 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| | Isonicotinoyl chloride hydrochloride Usage And Synthesis |
| Uses | Isonicotinyl Chloride Hydrochloride, is a heterocyclic building block used for the synthesis of various pharmaceutical and biologically active compounds. It can be used for the preparation of Tetrahydropyrroloquinolinone type dual inhibitors of Aromatase/Aldosterone Synthase, as a novel stagey for breast cancer patients with the risk of cardiovascular diseases. | | Chemical Properties | almost white to beige crystalline powder | | Uses | Isonicotinoyl chloride hydrochloride was used in the synthesis of 7,16-diisonicotinoyltetraaza[14]annulene. |
| | Isonicotinoyl chloride hydrochloride Preparation Products And Raw materials |
| Raw materials | Ethanol-->Diethyl ether-->Sulfuric acid-->Dichloromethane-->Thionyl chloride-->Toluene-->Sodium chloride-->Isonicotinic acid-->Isonicotinic acid chloride | | Preparation Products | propane-1,3-diyl diisonicotinate-->Pyridine-4-carboxylic acid pentafluorophenyl ester-->N-[2-(pyridine-4-carbonylamino)ethyl]pyridine-4-carboxamide-->4-Pyridinecarboxylic acid, 4,4'-(1,4-phenylene) ester-->but-2-yne-1,4-diyl diisonicotinate-->N-(4-Acetylphenyl)isonicotinamide-->tert-Butyl 4-(isonicotinamido)piperidine-1-carboxylate-->N-[(R)-9-Methyl-4-oxo-1-phenyl-3,4,6,7-tetrahydro[1,4]diazepino[6,7,1-HI]indol-3-yl]isonicotinamide-->Methyl 2-(pyridin-4-yl)-1,3-benzoxazole-7-carboxylate |
|