| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
| Company Name: |
LGM Pharma |
| Tel: |
1-(800)-881-8210 |
| Email: |
inquiries@lgmpharma.com |
- GADOPENTETIC ACID
-
- $100.00
-
2023-08-31
- CAS:80529-93-7
- Min. Order: 1bag
- Purity: 99
- Supply Ability: 5000
- Gadopentetic Acid
-
- $200.00
-
2023-06-26
- CAS:80529-93-7
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 1000kg/Month
|
| | GADOPENTETIC ACID Basic information |
| Product Name: | GADOPENTETIC ACID | | Synonyms: | gadoliniumdtpa;DIETHYLENETRIAMINEPENTAACETIC ACID, GADOLINIUM(III) DIHYDROGEN SALT HYDRATE;GADOPENTETIC ACID;GADOPENTETIC ACID HYDRATE;GADOLINIUM(II) DIETHYLENETRIAMINEPENTAACETIC ACID, HYDRATE;Gadopentetic;Diethylenetriaminepentaacetic acid hydrate gadolinium(III) dihydrogen salt;GADOPENTATIC ACID 80529-93-7 | | CAS: | 80529-93-7 | | MF: | C14H20GdN3O10 | | MW: | 547.57 | | EINECS: | 1592732-453-0 | | Product Categories: | | | Mol File: | 80529-93-7.mol |  |
| | GADOPENTETIC ACID Chemical Properties |
| Melting point | 129 °C (dec.)(lit.) | | storage temp. | Room Temperature | | solubility | Water (Slightly) | | form | Solid | | color | White | | InChI | InChI=1S/C14H23N3O10.Gd/c18-10(19)5-15(1-3-16(6-11(20)21)7-12(22)23)2-4-17(8-13(24)25)9-14(26)27;/h1-9H2,(H,18,19)(H,20,21)(H,22,23)(H,24,25)(H,26,27);/q;+3/p-3 | | InChIKey | IZOOGPBRAOKZFK-UHFFFAOYSA-K | | SMILES | N(CC([O-])=O)(CCN(CC([O-])=O)CC(=O)O)CCN(CC([O-])=O)CC(=O)O.[Gd+3] |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | GADOPENTETIC ACID Usage And Synthesis |
| Chemical Properties | white powder | | Uses | Diagnostic aid. | | Uses | Gadopentetic Acid is a magnetic resonance contrast agent being used to develop a new platform for the delivery of therapeutic and imaging agents simultaneously to the colon. | | Definition | ChEBI: Gadopentetate is a gadolinium coordination entity. It has a role as a MRI contrast agent. | | Brand name | Magnevist (Berlex). | | reaction suitability | core: gadolinium reagent type: catalyst |
| | GADOPENTETIC ACID Preparation Products And Raw materials |
|