- COOH-PEG5-COOMe
-
-
2025-06-07
- CAS:1309460-30-7
- Min. Order: 1g
- Purity: >98.00%
- Supply Ability: 1g
|
| | Acid-PEG5-mono-methyl ester Basic information |
| Product Name: | Acid-PEG5-mono-methyl ester | | Synonyms: | Acid-PEG5-mono-methyl ester;COOH-PEG5-COOMe;4,7,10,13,16-Pentaoxanonadecanedioic acid, 1-methyl ester;Acid-PEG5-Methyl Ester;MeOOCCH2CH2O-PEG4-CH2CH2COOH;COOH-PEG5-CH2CH2COOMe;3-oxo-2,6,9,12,15,18-hexaoxahenicosan-21-oic acid | | CAS: | 1309460-30-7 | | MF: | C15H28O9 | | MW: | 352.38 | | EINECS: | | | Product Categories: | | | Mol File: | 1309460-30-7.mol |  |
| | Acid-PEG5-mono-methyl ester Chemical Properties |
| Boiling point | 469.4±45.0 °C(Predicted) | | density | 1.151±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | solubility | Soluble in DCM | | pka | 4.28±0.10(Predicted) | | form | Liquid | | color | Colorless to light yellow | | InChI | InChI=1S/C15H28O9/c1-19-15(18)3-5-21-7-9-23-11-13-24-12-10-22-8-6-20-4-2-14(16)17/h2-13H2,1H3,(H,16,17) | | InChIKey | LSGMOHWEFFVQEO-UHFFFAOYSA-N | | SMILES | C(OC)(=O)CCOCCOCCOCCOCCOCCC(O)=O |
| | Acid-PEG5-mono-methyl ester Usage And Synthesis |
| Description | Acid-PEG5-mono-methyl ester is a PEG linker containing a terminal carboxylic acid and a mono-methyl ester functional group. The terminal carboxylic acid can react with primary amines in the presence of activators such as EDC and HATU to form stable amide bonds. The hydrophilic PEG linker increases the water solubility of compounds in aqueous media. | | Uses | Acid-PEG5-mono-methyl ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. | | IC 50 | PEGs | | References | [1] An S, et al. Small-molecule PROTACs: An emerging and promising approach for the development of targeted therapy drugs. EBioMedicine. 2018 Oct;36:553-562 DOI:10.1016/j.ebiom.2018.09.005 |
| | Acid-PEG5-mono-methyl ester Preparation Products And Raw materials |
|