| Company Name: |
Bide Pharmatech Ltd. Gold |
| Tel: |
400-164-7117 18317119277 |
| Email: |
product02@bidepharm.com |
- COOH-PEG4-COOtBu
-
-
2025-06-07
- CAS:1835759-85-7
- Min. Order: 1g
- Purity: >98.00%
- Supply Ability: 1g
|
| | Acid-PEG4-t-butyl ester Basic information |
| Product Name: | Acid-PEG4-t-butyl ester | | Synonyms: | Acid-PEG4-t-butyl ester;Di-tert-butyl 4,7,10,13-tetraoxahexadecane-1,16-dioate;COOH-PEG4-COOtBu;4,7,10,13-Tetraoxahexadecanedioic acid, 1-(1,1-dimethylethyl) ester;COOH-PEG4-OtBu;HOOCCH2CH2O-PEG3-CH2CH2COOtBu;Acid-PEG4-t-Bu Ester;HOOCCH2CH2O-PEG3-CH2CH2COOtBu/4,7,10,13-Tetraoxahexadecanedioic acid, 1-(1,1-dimethylethyl) ester | | CAS: | 1835759-85-7 | | MF: | C20H38O8 | | MW: | 350.4 | | EINECS: | | | Product Categories: | peg | | Mol File: | 1835759-85-7.mol |  |
| | Acid-PEG4-t-butyl ester Chemical Properties |
| Boiling point | 460.1±40.0 °C(Predicted) | | density | 1.107±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | solubility | Soluble in Water, DMSO, DCM, DMF | | pka | 4.28±0.10(Predicted) | | form | Liquid | | color | Colorless to light yellow | | InChI | InChI=1S/C16H30O8/c1-16(2,3)24-15(19)5-7-21-9-11-23-13-12-22-10-8-20-6-4-14(17)18/h4-13H2,1-3H3,(H,17,18) | | InChIKey | LXMHKDZTUDTSCT-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)CCOCCOCCOCCOCCC(O)=O |
| | Acid-PEG4-t-butyl ester Usage And Synthesis |
| Description | Acid-PEG4-t-butyl ester is a PEG linker containing a t-butyl protected carboxyl group with a terminal carboxylic acid. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. The hydrophilic PEG spacer increases solubility in aqueous media. The t-butyl protected carboxyl group can be deprotected under acidic conditions. | | Uses | Acid-PEG4-C2-Boc is a PEG- and Alkyl/ether-based PROTAC linker can be used in the synthesis of PROTACs for the inhibition of mTOR[1]. | | IC 50 | PEGs; Alkyl/ether | | References | [1] Jennifer PITZEN , et al. C40-, c28-, and c-32-linked rapamycin analogs as mtor inhibitors. WO2019212990A1. |
| | Acid-PEG4-t-butyl ester Preparation Products And Raw materials |
|