| Company Name: |
Rayge(SuZhou)New Materials Co.,Ltd
|
| Tel: |
0512-87813132-801 13913535368 |
| Email: |
3043369320@qq.com |
| Products Intro: |
Product Name:2,2-Dimethyl-1,3-dioxan-5-ol
CAS:3391-30-8
Purity:98% Package:1g;10g;100g;1kg
|
1,3-Dioxan-5-ol, 2,2-dimethyl- manufacturers
|
| | 1,3-Dioxan-5-ol, 2,2-dimethyl- Basic information |
| | 1,3-Dioxan-5-ol, 2,2-dimethyl- Chemical Properties |
| Boiling point | 90-91 °C(Press: 13 Torr) | | density | 1.0911 g/cm3 | | storage temp. | Storage temp. 2-8°C | | pka | 13.70±0.40(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C6H12O3/c1-6(2)8-3-5(7)4-9-6/h5,7H,3-4H2,1-2H3 | | InChIKey | CGNOMSJAJQUXAT-UHFFFAOYSA-N | | SMILES | O1CC(O)COC1(C)C |
| | 1,3-Dioxan-5-ol, 2,2-dimethyl- Usage And Synthesis |
| Uses | 2,2-Dimethyl-1,3-dioxan-5-ol is a useful synthetic compound. | | Synthesis Reference(s) | Canadian Journal of Chemistry, 73, p. 1616, 1995 DOI: 10.1139/v95-201 |
| | 1,3-Dioxan-5-ol, 2,2-dimethyl- Preparation Products And Raw materials |
| Raw materials | (2,2-dimethyl-5-nitro-1,3-dioxan-5-yl)methanol-->Hydroxylamine, O-(2,2-dimethyl-1,3-dioxan-5-yl)--->(5-AMINO-2,2-DIMETHYL-[1,3]DIOXAN-5-YL)-METHANOL-->2-BENZYLOXY-1,3-PROPANEDIOL-->2,2-DIMETHYL-1,3-DIOXAN-5-ONE-->2-Methoxypropene-->Acetone-->2,2-Dimethoxypropane-->2,2-Dimethyl-1,3-dioxolane-4-methanol |
|