|
|
| | (S)-Amino-(3-fluoro-phenyl)-acetic acid Basic information |
| Product Name: | (S)-Amino-(3-fluoro-phenyl)-acetic acid | | Synonyms: | 3-FLUOROPHENYLGLYCINE;(S)-2-(3-fluorophenyl)glycine;(2S)-2-amino-2-(3-fluorophenyl)acetic acid;S-3-FluoroPhenylglycine;(S)-2-Amino-2-(3-fluorophenyl)acetic acid;Benzeneacetic acid, α-amino-3-fluoro-, (αS)-;(2S)-2-amino-2-(3-fluorophenyl)aceticaci;(αS)-α-Amino-3-fluorobenzeneacetic acid | | CAS: | 154006-66-3 | | MF: | C8H8FNO2 | | MW: | 169.15 | | EINECS: | | | Product Categories: | pharmacetical | | Mol File: | 154006-66-3.mol |  |
| | (S)-Amino-(3-fluoro-phenyl)-acetic acid Chemical Properties |
| Boiling point | 286.5±30.0 °C(Predicted) | | density | 1.347±0.06 g/cm3(Predicted) | | storage temp. | Store at 0-8 °C | | pka | 1.74±0.10(Predicted) | | Appearance | off-white to pale yellow solid | | InChI | InChI=1/C8H8FNO2/c9-6-3-1-2-5(4-6)7(10)8(11)12/h1-4,7H,10H2,(H,11,12)/t7-/s3 | | InChIKey | LVYBCZIDQKJNFP-KPOCXSGKNA-N | | SMILES | C1(C=CC=C(F)C=1)[C@H](N)C(=O)O |&1:7,r| |
| | (S)-Amino-(3-fluoro-phenyl)-acetic acid Usage And Synthesis |
| | (S)-Amino-(3-fluoro-phenyl)-acetic acid Preparation Products And Raw materials |
|