|
|
| Product Name: | Cyanine7 amine | | Synonyms: | Cyanine7 amine;Cyanine7 amine,Cy7 NH2;1-(6-((6-Aminohexyl)amino)-6-oxohexyl)-3,3-dimethyl-2-(2-(3-(2-(1,3,3-trimethylindolin-2-ylidene)ethylidene)cyclohex-1-en-1-yl)vinyl)-3H-indol-1-ium;CY7-NH2 | | CAS: | 1650635-41-8 | | MF: | C43H59N4O+ | | MW: | 647.97 | | EINECS: | | | Product Categories: | | | Mol File: | 1650635-41-8.mol |  |
| | Cyanine7 amine Chemical Properties |
| solubility | Soluble in methanol, DMF and other organic solvents, slightly soluble in water | | Appearance | Green solid | | ex/em | 740/770 nm (MeOH/PBS) | | ε(extinction coefficient) | 199000 L⋅mol−1⋅cm−1 | | Φ(quantum yield) | 0.3 | | InChIKey | XKOKAUKNGUVUFA-UHFFFAOYSA-O | | SMILES | C([N+]1=C(C(C)(C)C2=CC=CC=C12)C=CC1CCCC(=CC=C2N(C3=CC=CC=C3C2(C)C)C)C=1)CCCCC(=O)NCCCCCCN |
| | Cyanine7 amine Usage And Synthesis |
| Application | The cyanine dye CY7-amino is often used in biomolecular labeling, fluorescence imaging, and other fluorescent bioanalysis. | | Description | Near-infrared dye with free amine group for the conjugation with activated esters and other reactive molecules.
Cyanine7 is a near-infrared dye, an analog of Cy7® which is especially suitable for live organism imaging, and demanding low-background applications. | | Chemical Properties | Appearance: Green solid
ex/em: 740/770 nm (MeOH/PBS)
Extinction coefficient (ε): 199000 Lmol1cm1
Quantum yield (Φ): 0.3 | | Abs/Em Maxima | 750/773 nm | | Fluoresene quantum yield | 0.3 | | Extinction Coefficient | 199000 | | CF260 | 0.022 | | CF280 | 0.029 |
| | Cyanine7 amine Preparation Products And Raw materials |
|