|
|
| | Cyanine7 maleimide Basic information |
| | Cyanine7 maleimide Chemical Properties |
| solubility | Soluble in methanol, DMF and other organic solvents, slightly soluble in water | | form | powder | | Appearance | Green solid | | ex/em | 740/770 nm (PBS buffer) | | ε(extinction coefficient) | 199000 L⋅mol−1⋅cm−1 | | Φ(quantum yield) | 0.3 | | SMILES | [Cl-].CN1\C(=C\C=C\C=C\C=C\C2=[N+](CCCCCC(=O)NCCN3C(=O)C=CC3=O)c3ccccc3C2(C)C)C(C)(C)c2ccccc12 |
| | Cyanine7 maleimide Usage And Synthesis |
| Description | Near-infrared, sulfhydryl reactive Cyanine7 dye, an analog of Cy7 maleimide._x000D_
_x000D_
This reagent allows to attach near infrared Cyanine7 dye to proteins with free sulfhydryl groups. Labeled proteins thus obtained are used in NIR bioimaging applications. NIR imaging systems can be used to visualize distribution of labeled proteins in tissues even in live organism. | | Chemical Properties | Appearance: Green solid
ex/em: 740/770 nm (PBS buffer)
Extinction coefficient (ε): 199000 Lmol1cm1
Quantum yield (Φ): 0.3 | | Abs/Em Maxima | 750/773 nm | | Fluoresene quantum yield | 0.3 | | Extinction Coefficient | 199000 | | CF260 | 0.022 | | CF280 | 0.029 |
| | Cyanine7 maleimide Preparation Products And Raw materials |
|