|
|
| | Posaconazole Impurity 43 Basic information | | Uses |
| Product Name: | Posaconazole Impurity 43 | | Synonyms: | Desethylene Posaconazole N(triazolonophenyl)-Formyl;Desethylene Posaconazole N,N’-Diformyl;Posaconazole Impurity 43;Posaconazole Desethylene Diformyl Impurity;N-(4-(((3R,5R)-5-((1H-1,2,4-triazol-1-yl)methyl)-5-(2,4-difluorophenyl)tetrahydrofuran-3-yl)methoxy)phenyl)-N-(2-(N-(4-(1-((2S,3S)-2-hydroxypentan-3-yl)-5-oxo-1H-1,2,4-triazol-4(5H)-yl)phenyl)formamido)ethyl)formamide;-Diformyl;N-(4-(((3R,5R)-5-((1H-1,2,4-triazol-1-yl)methyl)-5-(2,4-difluorophenyl)tetrahydrofuran-3-yl)methoxy)phenyl)-N-(2-(N-(4-(1-((2S,3S)-2-hydroxypentan-3-yl)-5-oxo-1,5-dihydro-4H-1,2,4-triazol-4-yl)phenyl)formamido)ethyl)formamide;Posaconazole Impurity B/ Posaconazole Desethylene Diformyl Impurity | | CAS: | 357189-95-8 | | MF: | C37H40F2N8O6 | | MW: | 730.7603064 | | EINECS: | | | Product Categories: | | | Mol File: | 357189-95-8.mol |  |
| | Posaconazole Impurity 43 Chemical Properties |
| Boiling point | 904.9±75.0 °C(Predicted) | | density | 1.36±0.1 g/cm3(Predicted) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 14.72±0.20(Predicted) | | form | Solid | | color | Light Brown to Brown | | InChIKey | ULPWZDUBQUNXKP-QQVIVNFKNA-N | | SMILES | C(N(CCN(C=O)C1=CC=C(OC[C@H]2C[C@@](C3=CC=C(F)C=C3F)(CN3C=NC=N3)OC2)C=C1)C1=CC=C(N2C(=O)N([C@@H](CC)[C@@H](O)C)N=C2)C=C1)=O |&1:13,15,42,45,r| |
| | Posaconazole Impurity 43 Usage And Synthesis |
| Uses | Desethylene Posaconazole N,N’-Diformyl is a degradation product of Posaconazole, which is an orally active triazole antifungal. | | Uses | Desethylene Posaconazole N,N’-Diformyl is a degradation product of Posaconazole (P689600), which is an orally active triazole antifungal. |
| | Posaconazole Impurity 43 Preparation Products And Raw materials |
|