Azido-PEG4-Amido-Tris manufacturers
- Azido-PEG4-Amido-Tris
-
-
2025-06-07
- CAS:1398044-55-7
- Min. Order: 250mg
- Purity: >98.00%
- Supply Ability: 250mg
|
| | Azido-PEG4-Amido-Tris Basic information |
| Product Name: | Azido-PEG4-Amido-Tris | | Synonyms: | Azido-PEG4-Amido-Tris;N3-PEG4-amido-Tris;N3-PEG4-CH2CH2CONH-C(CH2OH)3;1-Azido-N-(1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl)-3,6,9,12-tetraoxapentadecan-15-amide | | CAS: | 1398044-55-7 | | MF: | C15H30N4O8 | | MW: | 394.4207 | | EINECS: | | | Product Categories: | | | Mol File: | 1398044-55-7.mol |  |
| | Azido-PEG4-Amido-Tris Chemical Properties |
| storage temp. | Storage temp. 2-8°C | | solubility | Soluble in Water, DMSO, DCM, DMF | | form | Viscous Liquid | | color | Yellow to brown |
| | Azido-PEG4-Amido-Tris Usage And Synthesis |
| Description | Azido-PEG4-Amido-tri-(carboxyethoxymethyl)-methane is a multi-arm PEGylation reagent containing an azide group and three hydroxyl groups. The azide group enables Click Chemistry. The indicated molecular weight of the multi-arm PEG is the sum of the molecular weights of all the arms. | | Uses | Azido-PEG4-Amido-Tris is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Azido-PEG4-Amido-Tris is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | | IC 50 | PEGs | | References | [1] An S, et al. Small-molecule PROTACs: An emerging and promising approach for the development of targeted therapy drugs. EBioMedicine. 2018 Oct;36:553-562 DOI:10.1016/j.ebiom.2018.09.005 |
| | Azido-PEG4-Amido-Tris Preparation Products And Raw materials |
|