| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | (-)-cis-2-Benzylaminocyclohexanemethanol Basic information |
| | (-)-cis-2-Benzylaminocyclohexanemethanol Chemical Properties |
| Melting point | 67-69 °C(lit.) | | Boiling point | 352.8±15.0 °C(Predicted) | | density | 1.04±0.1 g/cm3(Predicted) | | refractive index | -24 ° (C=1, MeOH) | | storage temp. | 2-8°C, protect from light | | form | powder to crystal | | pka | 15.05±0.10(Predicted) | | color | White to Light yellow | | Optical Rotation | [α]20/D 24°, c = 1 in methanol | | BRN | 8393598 | | InChI | 1S/C14H21NO/c16-11-13-8-4-5-9-14(13)15-10-12-6-2-1-3-7-12/h1-3,6-7,13-16H,4-5,8-11H2/t13-,14-/m1/s1 | | InChIKey | BRQFIORUNWWNBM-ZIAGYGMSSA-N | | SMILES | OC[C@H]1CCCC[C@H]1NCc2ccccc2 | | CAS DataBase Reference | 71581-93-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2922.19.7000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (-)-cis-2-Benzylaminocyclohexanemethanol Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde |
| | (-)-cis-2-Benzylaminocyclohexanemethanol Preparation Products And Raw materials |
|