|
|
| | 4-Chloro-3-nitrobenzoic acid Basic information |
| | 4-Chloro-3-nitrobenzoic acid Chemical Properties |
| Melting point | 180-183 °C (lit.) | | Boiling point | 371.6±27.0 °C(Predicted) | | density | 1.64 | | refractive index | 1.6280 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | pka | 3.35±0.10(Predicted) | | form | Powder | | color | Light yellow to cream | | Water Solubility | 342.7mg/L(temperature not stated) | | BRN | 783626 | | InChI | InChI=1S/C7H4ClNO4/c8-5-2-1-4(7(10)11)3-6(5)9(12)13/h1-3H,(H,10,11) | | InChIKey | DFXQXFGFOLXAPO-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(Cl)C([N+]([O-])=O)=C1 | | CAS DataBase Reference | 96-99-1(CAS DataBase Reference) | | NIST Chemistry Reference | Benzoic acid, 4-chloro-3-nitro-(96-99-1) | | EPA Substance Registry System | Benzoic acid, 4-chloro-3-nitro- (96-99-1) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-24/25-36 | | WGK Germany | 2 | | RTECS | DG5425050 | | TSCA | TSCA listed | | HS Code | 29163900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-Chloro-3-nitrobenzoic acid Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder |
| | 4-Chloro-3-nitrobenzoic acid Preparation Products And Raw materials |
|