|
|
| | Eltanolone Basic information |
| Product Name: | Eltanolone | | Synonyms: | 3alpha,5beta-Epimeric pregnanolone;3alpha,5beta-Pregnanolone;3-alpha-hydroxy-5-beta-pregnan-20-on;Pregnan-20-one, 3-hydroxy-, (3a,5b)-;Pregnan-3α-ol-20-one;3a,5b-Epimeric pregnanolone;1-[(3R,5R,8R,9S,10S,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone;5B-Pregnan-3α-ol-20-one | | CAS: | 128-20-1 | | MF: | C21H34O2 | | MW: | 318.49 | | EINECS: | | | Product Categories: | Steroids;Pharmaceutical Intermediates | | Mol File: | 128-20-1.mol |  |
| | Eltanolone Chemical Properties |
| Melting point | 149°C | | alpha | D23 +59.6° (c = 0.3 in chloroform); D26 +108.5 ±1° (c = 9.23 mg/1.23 ml abs ethanol) | | Boiling point | 397.64°C (rough estimate) | | density | 1.0234 (rough estimate) | | refractive index | 1.5344 (estimate) | | storage temp. | Store at RT | | solubility | Chloroform (Slightly), Ethanol (Slightly), Methanol (Slightly) | | pka | 15.12±0.70(Predicted) | | form | Solid | | color | White to Off-White | | biological source | synthetic (organic) | | Water Solubility | 8mg/L(room temperature) | | InChI | 1S/C21H34O2/c1-13(22)17-6-7-18-16-5-4-14-12-15(23)8-10-20(14,2)19(16)9-11-21(17,18)3/h14-19,23H,4-12H2,1-3H3 | | InChIKey | AURFZBICLPNKBZ-UHFFFAOYSA-N | | SMILES | [H]C12CCC3C4CCC(C(C)=O)C4(C)CCC3C1(C)CC[C@H](O)C2 | | NIST Chemistry Reference | 3Alpha-hydroxy-5beta-pregnan-20-one(128-20-1) |
| Hazard Codes | Xn | | Risk Statements | 40 | | Safety Statements | 22-36 | | WGK Germany | 3 | | RTECS | TU4384000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Carc. 2 | | Toxicity | LD50 in mice, rats (mg/kg): 66 ± 10, 27.5 ± 2.4 i.v. (Gyermek) |
| | Eltanolone Usage And Synthesis |
| Uses | A hyponotic-anaesthetic agent. | | Definition | ChEBI: The 3alpha-stereoisomer of 3-hydroxy-5beta-pregnan-20-one. | | Biological Activity | GABA A receptor positive allosteric modulator. Neuroactive steroid. | | Biochem/physiol Actions | 5β-Pregnan-3α-ol-20-one or pregnanolone is a neurosteroid that acts as a positive allosteric modulator (PAMs) of γ-aminobutyric acid A receptors (GABAARs). It mediates anti-convulsive, anxiolytic and sedative effects. Pregnanolone inhibits γ-aminobutyric acid C receptor (GABAC) receptor-based response and favors GABAAreceptor-mediated currents. | | storage | Store at RT |
| | Eltanolone Preparation Products And Raw materials |
|