| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Bis(4-fluorophenyl)chlorophosphine Basic information |
| Product Name: | Bis(4-fluorophenyl)chlorophosphine | | Synonyms: | Chlorobis(4-fluorophenyl)phosphine, 98+%;Chlorobis(4-fluorophenyl)phosphine, 98%;Bis(4-fluorophenyl) chlorophosphine, Min. 98%;Phosphinous chloride, P,P-bis(4-fluorophenyl)-;BIS(4-FLUOROPHENYL)CHLOROPHOSPHINE,MIN.98%;Bis(4-fluorophenyl)phosphinous chloride;Bis(4-fluorophenyl)chlorophosphine | | CAS: | 23039-97-6 | | MF: | C12H8ClF2P | | MW: | 256.62 | | EINECS: | | | Product Categories: | | | Mol File: | 23039-97-6.mol |  |
| | Bis(4-fluorophenyl)chlorophosphine Chemical Properties |
| Boiling point | 110 °C(Press: 1 Torr) | | storage temp. | 2-8°C, protect from light, stored under nitrogen | | form | liquid | | color | pale yellow | | Water Solubility | Reacts with water. | | Sensitive | Moisture Sensitive | | InChI | 1S/C12H8ClF2P/c13-16(11-5-1-9(14)2-6-11)12-7-3-10(15)4-8-12/h1-8H | | InChIKey | PYFWYPBHSZATST-UHFFFAOYSA-N | | SMILES | Fc1ccc(cc1)P(Cl)c2ccc(cc2)F |
| RIDADR | UN3265 | | WGK Germany | WGK 3 | | HazardClass | 8 | | PackingGroup | II | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Chronic 3
Eye Dam. 1
Skin Corr. 1B |
| | Bis(4-fluorophenyl)chlorophosphine Usage And Synthesis |
| Uses | In chemical research. Used as an interphasic transfer catalyst, a polymerization catalyst, and a trans-halogenation catalyst. As a precursor to fire-retardant materials. |
| | Bis(4-fluorophenyl)chlorophosphine Preparation Products And Raw materials |
|