| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Bis(3,5-dimethylphenyl)chlorophosphine Basic information |
| Product Name: | Bis(3,5-dimethylphenyl)chlorophosphine | | Synonyms: | Bis(3,5-dimethylphenyl)chlorophosphine,98%;Chlorobis(3,5-dimethylphenyl)phosphine, tech. 90%;Bis(3,5-dimethylphenyl)phosphine chloride;Bis(3,5-dimethylphenyl)phosphinous chloride;chloro-bis(3,5-dimethylphenyl)phosphane;Chlorobis(3,5-dimethylphenyl)phosphine;Bis(3,5-dimethylphenyl)chlorophosphine, tech.;Phosphinous chloride, P,P-bis(3,5-dimethylphenyl)- | | CAS: | 74289-57-9 | | MF: | C16H18ClP | | MW: | 276.74 | | EINECS: | 636-136-8 | | Product Categories: | Catalysis and Inorganic Chemistry;Phosphorus Compounds;Phosphorus Precursors | | Mol File: | 74289-57-9.mol |  |
| | Bis(3,5-dimethylphenyl)chlorophosphine Chemical Properties |
| Boiling point | 115-135 °C(Press: 0.015 Torr) | | density | 1.102 g/mL at 25 °C | | refractive index | n20/D 1.606 | | Fp | 110 °C | | storage temp. | 2-8°C, protect from light, stored under nitrogen | | form | liquid | | Appearance | Colorless to light yellow Liquid | | Water Solubility | Reacts with water. | | Sensitive | Moisture Sensitive | | InChI | 1S/C16H18ClP/c1-11-5-12(2)8-15(7-11)18(17)16-9-13(3)6-14(4)10-16/h5-10H,1-4H3 | | InChIKey | FCEBDAANWYNQMO-UHFFFAOYSA-N | | SMILES | Cc1cc(C)cc(c1)P(Cl)c2cc(C)cc(C)c2 |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-43-45 | | RIDADR | UN3261 | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | II | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | Bis(3,5-dimethylphenyl)chlorophosphine Usage And Synthesis |
| Uses | Chlorobis(3,5-dimethylphenyl)phosphine is used in the synthesis of (S)- and (R)-2,2-Bis[bis(3,5-dimethylphenyl)phosphinoyl]-5,5,6,6,7,7,8,8-octahydro-1,1-binaphthyl (Xyl-H 8 -BINAPO). | | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling reagent type: ligand |
| | Bis(3,5-dimethylphenyl)chlorophosphine Preparation Products And Raw materials |
|