|
|
| | Ethyl 5-nitrobenzofuran-2-carboxylate Basic information |
| | Ethyl 5-nitrobenzofuran-2-carboxylate Chemical Properties |
| Melting point | 152-156 °C | | Boiling point | 377.58°C (rough estimate) | | density | 1.362 | | refractive index | 1.4950 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | slightly sol. in Acetone | | form | powder to crystal | | color | Light yellow to Amber to Dark green | | InChI | 1S/C11H9NO5/c1-2-16-11(13)10-6-7-5-8(12(14)15)3-4-9(7)17-10/h3-6H,2H2,1H3 | | InChIKey | ATHBGWVHAWGMAL-UHFFFAOYSA-N | | SMILES | CCOC(=O)c1cc2cc(ccc2o1)[N+]([O-])=O |
| Hazard Codes | Xi | | Safety Statements | 22-24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29329990 | | Storage Class | 13 - Non Combustible Solids |
| Provider | Language |
|
ACROS
| English |
| | Ethyl 5-nitrobenzofuran-2-carboxylate Usage And Synthesis |
| Chemical Properties | Light yellow to light brown powder | | Uses | Deriatives of benzofuran-2-carboxylic acid are known for exhibiting various pharmacological activities such as selective adenosine A2A receptor antagonists, anti-inflammatory agents and local anaesthetics. Benzofuran-2-carboxylic acids bearing benzoyl nitrogen such as Ethyl 5-Nitrobenzofuran-2-carboxylate, are used as DNA-binding groups, where the these structural subunits mimic natural antitumor agents such as duocarmycin and netropsin. |
| | Ethyl 5-nitrobenzofuran-2-carboxylate Preparation Products And Raw materials |
|