| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3-(4-Chlorbutyl)-1H-indol-5-carbonitril Basic information | | Synthesis |
| | 3-(4-Chlorbutyl)-1H-indol-5-carbonitril Chemical Properties |
| Melting point | 99-100℃ | | Boiling point | 448.1±35.0 °C(Predicted) | | density | 1.22 | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | Chloroform (Slightly, Ethyl Acetate (Slightly) | | form | Solid | | pka | 15.93±0.30(Predicted) | | color | Off-White to Pale Beige | | InChI | InChI=1S/C13H13ClN2/c14-6-2-1-3-11-9-16-13-5-4-10(8-15)7-12(11)13/h4-5,7,9,16H,1-3,6H2 | | InChIKey | NJJWMEJWFYRORL-UHFFFAOYSA-N | | SMILES | N1C2=C(C=C(C#N)C=C2)C(CCCCCl)=C1 | | CAS DataBase Reference | 143612-79-7 |
| | 3-(4-Chlorbutyl)-1H-indol-5-carbonitril Usage And Synthesis |
| Synthesis | 3-(4-Chlorbutyl)-1H-indol-5-carbonitril can be obtained from 5-cyanoindole and 4-chlorobutyryl chloride via acylation and reduction reactions. First, using 5-cyanoindole and 4-chlorobutyryl chloride as raw materials, and dichloromethane as solvent, 5-cyanoindole was acylated by FC reaction under the catalysis of isobutylaluminum dichloride to obtain chlorobutyryl-substituted 5-cyanoindole (yield 82%). Then, again in dichloromethane, using isobutylaluminum dichloride as catalyst and sodium borohydride as reducing agent, the target compound 3-(4-Chlorbutyl)-1H-indol-5-carbonitril was successfully synthesized. 
| | Uses | Reactant in the preparation of allosteric IGF-1R inhibitors, and dual 5-HT1A receptor agonists and serotonin reuptake inhibitors. |
| | 3-(4-Chlorbutyl)-1H-indol-5-carbonitril Preparation Products And Raw materials |
|