| Company Name: |
Mainchem Co., Ltd.
|
| Tel: |
+86-0592-6210733 |
| Email: |
sale@mainchem.com |
| Products Intro: |
Product Name:(1R)-10-CAMPHORSULFONAMIDE CAS:72597-34-3
|
|
| | (1R)-10-CAMPHORSULFONAMIDE Basic information |
| | (1R)-10-CAMPHORSULFONAMIDE Chemical Properties |
| Melting point | 133-135 °C (lit.) | | Boiling point | 380.4±34.0 °C(Predicted) | | density | 1.280±0.06 g/cm3(Predicted) | | solubility | Dichloromethane | | pka | 10.14±0.60(Predicted) | | form | Powder | | color | Off-White | | Optical Rotation | [α]20/D 22°, c = 1 in methanol | | InChI | 1S/C10H17NO3S/c1-9(2)7-3-4-10(9,8(12)5-7)6-15(11,13)14/h7H,3-6H2,1-2H3,(H2,11,13,14)/t7-,10-/m0/s1 | | InChIKey | SBLUNABTQYDFJM-XVKPBYJWSA-N | | SMILES | CC1(C)[C@H]2CC[C@]1(CS(N)(=O)=O)C(=O)C2 | | CAS DataBase Reference | 72597-34-3(CAS DataBase Reference) |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | (1R)-10-CAMPHORSULFONAMIDE Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | (1R)-10-Camphorsulfonamide is a useful synthetic intermediate. Used for asymmetric hydroxylation | | Uses | (1R)-10-Camphorsulfonamide is an amino chiral derivative of Camphor | | Uses | An amino chiral derivative of Camphor. |
| | (1R)-10-CAMPHORSULFONAMIDE Preparation Products And Raw materials |
|