CARBOXYPEPTIDASE B manufacturers
- Recombinant Carboxypeptidase B
-
- $3.00 / 25KG
-
2025-10-13
- CAS:9025-24-5
- Min. Order: 0.1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
- CARBOXYPEPTIDASE B
-
- $80.00 / 1kg
-
2025-06-03
- CAS:9025-24-5
- Min. Order: 10kg
- Purity: 0.99
- Supply Ability: 20tons
- CARBOXYPEPTIDASE B
-
- $1.00 / 1KG
-
2020-03-12
- CAS:9025-24-5
- Min. Order: 100KG
- Purity: 99.0%
- Supply Ability: 1000kg
|
| | CARBOXYPEPTIDASE B Basic information |
| Product Name: | CARBOXYPEPTIDASE B | | Synonyms: | PROTEIN CARBOXYPEPTIDASE B;PROTAMINASE;PEPTIDYL-L-LYSINE[L-ARGININE] HYDROLASE;CARBOXYPEPTIDASE B, PORCINE PANCREAS;EC 3.4.17.2;IUB: 3.4.17.2;carboxypeptidase B from hog pancreas;RecoMbinant Carboxypeptidase B | | CAS: | 9025-24-5 | | MF: | C31H38N4O7S | | MW: | 610.72102 | | EINECS: | 232-788-9 | | Product Categories: | | | Mol File: | 9025-24-5.mol |  |
| | CARBOXYPEPTIDASE B Chemical Properties |
| storage temp. | -20°C | | solubility | water: 1 mg/mL | | form | powder | | color | white | | biological source | Porcine pancreas | | Water Solubility | water: 1mg/mL | | Specific Activity | 50-55units/mg protein carboxypeptidase B | | InChIKey | TWURVFFNODFJBJ-UHFFFAOYSA-N | | SMILES | C(O)(=O)CCC(NC(C)C(NC(C)C(N1CCCC1C(=O)NC(CC1=CC=CC=C1)C(SCC1=CC=CC=C1)=O)=O)=O)=O |
| Hazard Codes | Xi,B,Xn | | Risk Statements | 36-42-36/37/38 | | Safety Statements | 26-36-36/37-24-22 | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Resp. Sens. 1
Skin Irrit. 2
STOT SE 3 |
| | CARBOXYPEPTIDASE B Usage And Synthesis |
| Uses | The enzyme from Sigma has been used to develop homogeneous time-resolved fluorescence (HTRF) assay for measuring carboxypeptidase B activity in a miniaturized high-throughput screening format. It has been used to evaluate the impact of the C-terminal lysine(s) in human plasminogen binding to Bifidobacterium. The effect of treatment with carboxypeptidase B, which is a C-terminal lysine-specific endopeptidase, is measured using flow cytometry analysis. | | Uses | Carboxypeptidase B from Sigma has been used as a reference for assaying carboxypeptidase activity in lysed pituitary granules derived from the anterior and intermediate lobes of rat. The enzyme has also been used to digest plasma samples by removing C-terminal basic amino acids, to get a distinct band for each allotype during C4 electrophoresis. | | General Description | Native carboxypeptidase B catalyzes the release of C-terminal from basic amino acids, arginine, lysine, or ornithine from polypeptides. Inhibited by EDTA and other Zn2+ chelators. | | Biochem/physiol Actions | Carboxypeptidase B is a proteolytic enzyme capable of rapidly hydrolyzing peptide bonds to release certain carboxyl-terminal basic amino acids from peptides and proteins. Its molecular mass is 34,300±600 Da. It contains one non-dialyzable gram atom of zinc per mole. The enzyme activity is inhibited by metal chelating agents 1, 10-phenanthroline, 8-hydroxyquinoline-5-sulfonic acid, and 2,2′-dipyridyl. |
| | CARBOXYPEPTIDASE B Preparation Products And Raw materials |
|