|
|
| | N,N-Diphenylhydrazinium chloride Basic information |
| Product Name: | N,N-Diphenylhydrazinium chloride | | Synonyms: | Hydrazine, 1,1-diphenyl-, hydrochloride;N,N-Diphenylhydrazinium chloride for synthesis;N,N-DIPHENYLHYDRAZINE HYDROCHLORIDE;N,N-DIPHENYLHYDRAZINIUM CHLORIDE;TIMTEC-BB SBB003350;1,1-diphenyl-hydrazinmonohydrochloride;ASYM-DIPHENYLHYDRAZINE HYDROCHLORIDE;1,1-DIPHENYLHYDRAZINE HYDROCHLORIDE | | CAS: | 530-47-2 | | MF: | C12H13ClN2 | | MW: | 220.7 | | EINECS: | 208-481-0 | | Product Categories: | Aromatic Hydrazides, Hydrazines, Hydrazones and Oximes;pharmacetical;Phenylhydrazine | | Mol File: | 530-47-2.mol |  |
| | N,N-Diphenylhydrazinium chloride Chemical Properties |
| Melting point | 162-166 °C (dec.) | | storage temp. | Inert atmosphere,2-8°C | | form | powder to crystal | | color | White to Dark green | | Water Solubility | soluble | | Merck | 14,3325 | | BRN | 3569340 | | InChI | InChI=1S/C12H12N2.ClH/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12;/h1-10H,13H2;1H | | InChIKey | MIVUDWFNUOXEJM-UHFFFAOYSA-N | | SMILES | N(C1C=CC=CC=1)(C1C=CC=CC=1)N.Cl | | CAS DataBase Reference | 530-47-2(CAS DataBase Reference) | | EPA Substance Registry System | 1,1-Diphenylhydrazine hydrochloride (530-47-2) |
| Hazard Codes | C,Xn | | Risk Statements | 20/21/22-34-36/37/38 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | RTECS | MV3520000 | | F | 8 | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29280090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Acute 1
Aquatic Chronic 1
Eye Dam. 1
Skin Corr. 1B |
| | N,N-Diphenylhydrazinium chloride Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | N,N-Diphenylhydrazine hydrochloride is used in the synthesis of 2-Vinyloxyethyloxy-4-diethylaminophenyl-1-carbaldehyde N,N-diphenylhydrazone (hole-transporting hydrazine). |
| | N,N-Diphenylhydrazinium chloride Preparation Products And Raw materials |
|