|
|
| | 1,3,5-TRIMETHYLADAMANTANE Basic information |
| Product Name: | 1,3,5-TRIMETHYLADAMANTANE | | Synonyms: | tricyclo[3.3.1.1~3,7~]decane, 1,3,5-trimethyl-;1,3,5-triMethyladaMantan;1,3,5-TriMethyltricyclo[3.3.1.13,7]decane;1,3,5-TRIMETHYLADAMANTANE;1,3,5-trimethyladamantane 707-35-7 1gm;1,3,5-Trimethyladamentane;(1s,3s,5s)-1,3,5-trimethyladamantane;1,3,5 TRIMETHYL ADMANTANE | | CAS: | 707-35-7 | | MF: | C13H22 | | MW: | 178.31 | | EINECS: | | | Product Categories: | Adamantane derivatives;Aliphatics;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 707-35-7.mol |  |
| | 1,3,5-TRIMETHYLADAMANTANE Chemical Properties |
| Boiling point | 88.0-89.5 °C(Press: 19 Torr) | | density | 0.970±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform, Methanol (Slightly) | | form | Oil | | color | Clear Colourless | | InChI | InChI=1S/C13H22/c1-11-4-10-5-12(2,7-11)9-13(3,6-10)8-11/h10H,4-9H2,1-3H3 | | InChIKey | WCACLGXPFTYVEL-UHFFFAOYSA-N | | SMILES | C12(C)CC3(C)CC(CC(C)(C3)C1)C2 |
| | 1,3,5-TRIMETHYLADAMANTANE Usage And Synthesis |
| Chemical Properties | Clear Colourless Oil | | Uses | 1,3,5-Trimethyladamantane is an alkyladamantane derivative that are biotransformed via strains of Pseudomonas. It is used to study alkyladamantane adsorption on graphitized thermal carbon black. |
| | 1,3,5-TRIMETHYLADAMANTANE Preparation Products And Raw materials |
|