| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | ANTI-(1R)-(+)-CAMPHORQUINONE 3-OXIME Basic information |
| Product Name: | ANTI-(1R)-(+)-CAMPHORQUINONE 3-OXIME | | Synonyms: | (1R,E)-(+)-2,3-BORNANEDIONE 3-OXIME;(1R,E)-(+)-CAMPHORQUINONE 3-OXIME;ANTI-(1R)-(+)-2,3-BORNANEDIONE 3-OXIME;ANTI-(1R)-(+)-CAMPHORQUINONE 3-OXIME;ISONITROSO-D-CAMPHOR;ANTI-(1R)-(+)-CAMPHORQUINONE 3-OXIME, 99 %;(1R,E)-(+)-2,3-Bornanedione 3-oxime, anti-(1R;(1R,E)-(+)-2,3-Bornanedione 3-oxime, anti-(1R)-(+)-Camphorquinone 3-oxime | | CAS: | 31571-14-9 | | MF: | C10H15NO2 | | MW: | 181.23 | | EINECS: | | | Product Categories: | Bicyclic Monoterpenes;Biochemistry;Terpenes | | Mol File: | 31571-14-9.mol |  |
| | ANTI-(1R)-(+)-CAMPHORQUINONE 3-OXIME Chemical Properties |
| Melting point | 153-156 °C(lit.) | | Boiling point | 276.8±7.0 °C(Predicted) | | density | 1.25±0.1 g/cm3(Predicted) | | refractive index | 196 ° (C=1, EtOH) | | storage temp. | 2-8°C | | pka | 9.35±0.60(Predicted) | | form | powder to crystal | | color | White to Orange to Green | | Optical Rotation | [α]25/D +200°, c = 1 in ethanol | | Sensitive | Air Sensitive | | BRN | 3200377 | | InChI | 1S/C10H15NO2/c1-9(2)6-4-5-10(9,3)8(12)7(6)11-13/h6,13H,4-5H2,1-3H3/b11-7-/t6-,10+/m1/s1 | | InChIKey | YRNPDSREMSMKIY-HAKKTOSXSA-N | | SMILES | [H][C@@]12CC[C@@](C)(C(=O)\C1=N/O)C2(C)C |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 2928.00.5000 | | Storage Class | 11 - Combustible Solids |
| | ANTI-(1R)-(+)-CAMPHORQUINONE 3-OXIME Usage And Synthesis |
| Uses | (1R,E)-(+)-Camphorquinone 3-oxime can be used to prepare chiral camphor-oxazoline auxiliary, which is used to blend diastereoselectivity and isomer separability for the efficient synthesis of bicuculline, egenine, corlumine, and corytensine. |
| | ANTI-(1R)-(+)-CAMPHORQUINONE 3-OXIME Preparation Products And Raw materials |
|