|
|
| | Amoxicillin Impurity 3 Basic information |
| Product Name: | Amoxicillin Impurity 3 | | Synonyms: | Amoxicillin Impurity 3;Amoxicillin Impurity 20;Amoxicillin impurity 21/Amoxicilloic Acid Dimer (Mixture of Diastereomers);Amoxicillin Impurity 8;Amoxicilloic amoxilloic acid dimers 1, 2, 3, and 4;Amoxicilloic Acid Dimer (Mixture of Diastereomers);Glycinamide, (2R)-2-(4-hydroxyphenyl)glycyl-(2R)-2-[(2S,4S)-4-carboxy-5,5-dimethyl-2-thiazolidinyl]glycyl-N-[[(2S,4S)-4-carboxy-5,5-dimethyl-2-thiazolidinyl]methyl]-2-(4-hydroxyphenyl)-, (2R)- (9CI);the Mixture of Dimers 1,2,3 ,4 of Amoxicillin | | CAS: | 297175-66-7 | | MF: | C31H40N6O9S2 | | MW: | 704.82 | | EINECS: | | | Product Categories: | | | Mol File: | 297175-66-7.mol |  |
| | Amoxicillin Impurity 3 Chemical Properties |
| Boiling point | 1131.4±65.0 °C(Predicted) | | density | 1.395±0.06 g/cm3(Predicted) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | Methanol (Slightly), Water (Slightly) | | pka | 1.93±0.60(Predicted) | | form | Solid | | color | White to Off-White | | Stability: | Hygroscopic, Temperature Sensitive | | Major Application | pharmaceutical small molecule | | InChIKey | RGAGJTPTUXNKFG-YKARGWPLSA-N | | SMILES | C(N)(=O)[C@@H](C1=CC=C(O)C=C1)N(C(=O)C([C@H]1N[C@@H](C(O)=O)C(C)(C)S1)NC(=O)C(C1=CC=C(O)C=C1)N)C[C@H]1N[C@@H](C(O)=O)C(C)(C)S1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Amoxicillin Impurity 3 Usage And Synthesis |
| Uses | Amoxicilloic Acid Dimer is an impurity of Amoxicillin (A634528), a semi-synthetic antibiotic related to Penicillin. |
| | Amoxicillin Impurity 3 Preparation Products And Raw materials |
|