| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-Methyl-5-nonanol Basic information |
| Product Name: | 4-Methyl-5-nonanol | | Synonyms: | 4-Methylnonan-1-ol;5-Nonanol, 4-methyl-;4-Methyl-5-nonanol, GC 98%;4-Methyl-nonan-5-ol , (4-Methyl-5-Nonanol);Rhynchophorus ferrugineus;FERRUGINEOL;4-Methyl-5-nonanol | | CAS: | 154170-44-2 | | MF: | C10H22O | | MW: | 158.28 | | EINECS: | | | Product Categories: | | | Mol File: | 154170-44-2.mol |  |
| | 4-Methyl-5-nonanol Chemical Properties |
| Boiling point | 206.4±8.0℃ (760 Torr) | | density | 0.824±0.06 g/cm3 (20 ºC 760 Torr) | | Fp | 87.9±8.7℃ | | refractive index | 1.4360 | | pka | 15.12±0.20(Predicted) | | Odor | at 100.00 %. spicy herbal | | Odor Type | spicy | | InChI | InChI=1S/C10H22O/c1-4-6-8-10(11)9(3)7-5-2/h9-11H,4-8H2,1-3H3 | | InChIKey | MBZNNOPVFZCHID-UHFFFAOYSA-N | | SMILES | CCCC(C)C(O)CCCC | | LogP | 3.584 (est) | | CAS DataBase Reference | 154170-44-2(CAS DataBase Reference) | | EPA Substance Registry System | 5-Nonanol, 4-methyl- (154170-44-2) |
| Provider | Language |
|
ALFA
| English |
| | 4-Methyl-5-nonanol Usage And Synthesis |
| Uses | 4-Methyl-5-nonanol is a pheromone of the sugarcane weevil M. hemipterus. |
| | 4-Methyl-5-nonanol Preparation Products And Raw materials |
|