| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- 2-ETHYLBENZALDEHYDE
-
- $1.00
-
2020-01-13
- CAS:22927-13-5
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 100KG
|
| | 2-Ethylbenzaldehyde Basic information |
| | 2-Ethylbenzaldehyde Chemical Properties |
| Melting point | 210 °C | | Boiling point | 212 °C (lit.) | | density | 1.02 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.538(lit.) | | Fp | 230 °F | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Oil | | color | Colourless | | InChI | InChI=1S/C9H10O/c1-2-8-5-3-4-6-9(8)7-10/h3-7H,2H2,1H3 | | InChIKey | NTWBHJYRDKBGBR-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC=CC=C1CC | | LogP | 2.631 (est) |
| WGK Germany | 3 | | HS Code | 2912290090 | | Storage Class | 10 - Combustible liquids |
| | 2-Ethylbenzaldehyde Usage And Synthesis |
| Uses | A volatile derivative of benzaldehyde present in animal-derived food products. | | Uses | Reactant for:
- Preparation of potential antibacterial agents
- Asymmetric addition reactions
- Solid-phase synthesis of BODIPY dyes and development of an Ig fluorescent sensor
- Condensation reactions with phenylenediamine or aminothiophenol catalyzed by Mesoporous mixed metal oxide nanocrystals preparaed from aero gel process
|
| | 2-Ethylbenzaldehyde Preparation Products And Raw materials |
|