| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
2-BENZYLOXYBENZYL ALCOHOL manufacturers
|
| | 2-BENZYLOXYBENZYL ALCOHOL Basic information |
| Product Name: | 2-BENZYLOXYBENZYL ALCOHOL | | Synonyms: | 2-(Benzyloxy)benzyl alcohol 97%;2-(Benzyloxy)benzenemethanol;o-Benzyloxybenzyl alcohol;[2-(phenylmethoxy)phenyl]methanol;2-Benzylocybenzyl Alcohol;2-Benzyloxybenzyl Alcohol >;Benzenemethanol, 2-(phenylmethoxy)-;2-(Phenylmethoxy)benzenemethanol | | CAS: | 3381-87-1 | | MF: | C14H14O2 | | MW: | 214.26 | | EINECS: | | | Product Categories: | | | Mol File: | 3381-87-1.mol |  |
| | 2-BENZYLOXYBENZYL ALCOHOL Chemical Properties |
| Melting point | 36.5-37.5 °C | | Boiling point | 155 °C / 4mmHg | | density | 1.139±0.06 g/cm3(Predicted) | | Fp | 37 °C | | storage temp. | Store at room temperature | | form | powder to lump to clear liquid | | pka | 14.40±0.10(Predicted) | | color | White or Colorless to Yellow | | InChI | InChI=1S/C14H14O2/c15-10-13-8-4-5-9-14(13)16-11-12-6-2-1-3-7-12/h1-9,15H,10-11H2 | | InChIKey | XRZMRABYCSOXIZ-UHFFFAOYSA-N | | SMILES | C1(CO)=CC=CC=C1OCC1=CC=CC=C1 |
| RTECS | DN8582000 | | HS Code | 2916399090 | | Toxicity | frog,LDLo,unreported,360mg/kg (360mg/kg),BEHAVIORAL: ALTERED SLEEP TIME (INCLUDING CHANGE IN RIGHTING REFLEX)BEHAVIORAL: ATAXIABEHAVIORAL: SOMNOLENCE (GENERAL DEPRESSED ACTIVITY),Journal of Pharmacology and Experimental Therapeutics. Vol. 24, Pg. 423, 1925. |
| | 2-BENZYLOXYBENZYL ALCOHOL Usage And Synthesis |
| | 2-BENZYLOXYBENZYL ALCOHOL Preparation Products And Raw materials |
|