|
|
| | 4-(4-(DIMETHYLAMINO)STYRYL)PYRIDINE 95 Basic information |
| | 4-(4-(DIMETHYLAMINO)STYRYL)PYRIDINE 95 Chemical Properties |
| Melting point | 245-247 °C (dec.) (lit.) | | form | solid | | λmax | 377 nm | | InChI | 1S/C15H16N2/c1-17(2)15-7-5-13(6-8-15)3-4-14-9-11-16-12-10-14/h3-12H,1-2H3/b4-3+ | | InChIKey | LIXUVTQYCRSIET-ONEGZZNKSA-N | | SMILES | CN(C)c1ccc(\C=C\c2ccncc2)cc1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-(4-(DIMETHYLAMINO)STYRYL)PYRIDINE 95 Usage And Synthesis |
| | 4-(4-(DIMETHYLAMINO)STYRYL)PYRIDINE 95 Preparation Products And Raw materials |
|