|
|
| | DITHIO-BIS-MALEIMIDOETHANE Basic information |
| Product Name: | DITHIO-BIS-MALEIMIDOETHANE | | Synonyms: | 1,1'-(Dithiodi-2,1-ethanediyl)bis-1H-pyrrole-2,5-dione;1-[2-[[2-(2,5-Dihydro-2,5-dioxo-1H-pyrrol-1-yl)ethyl]dithio]ethyl]-1H-pyrrole-2,5-dione;Bis(2-maleimidoethyl) Disulfide;CAS_71865-37-7;1H-Pyrrole-2,5-dione, 1-[2-[[2-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)ethyl]dithio]ethyl]-;1-[2-[2-(2,5-dioxopyrrol-1-yl)ethyldisulfanyl]ethyl]pyrrole-2,5-dione;1,1'-[Disulfanediylbis(ethane-2,1-diyl)]bis(1H-pyrrole-2,5-dione);DTME (dithio-bis-maleimid&&oelig | | CAS: | 71865-37-7 | | MF: | C12H12N2O4S2 | | MW: | 312.36 | | EINECS: | | | Product Categories: | Maleimide Derivatives;Cross Linking Reagents;MTS & Sulfhydryl Active Reagents | | Mol File: | 71865-37-7.mol |  |
| | DITHIO-BIS-MALEIMIDOETHANE Chemical Properties |
| Melting point | 124°C | | Boiling point | 518.6±35.0 °C(Predicted) | | density | 1.511±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly) | | form | powder to crystal | | pka | -2.05±0.20(Predicted) | | color | White to Light yellow | | Stability: | Temperature Sensitve, Moisture Sensitive | | InChI | 1S/C12H12N2O4S2/c15-9-1-2-10(16)13(9)5-7-19-20-8-6-14-11(17)3-4-12(14)18/h1-4H,5-8H2 | | InChIKey | SGVWDRVQIYUSRA-UHFFFAOYSA-N | | SMILES | O=C(C=CC1=O)N1CCSSCCN2C(C=CC2=O)=O |
| WGK Germany | WGK 3 | | HS Code | 2930.90.9250 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | DITHIO-BIS-MALEIMIDOETHANE Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | A sulfhydryl reactive homobifunctional crosslinking reagent.
Spacer Arm: 13.3 Angstroms | | Uses | A sulfhydryl reactive homobifunctional crosslinking reagent.Spacer Arm: 13.3 Angstroms | | General Description | DTME is a homobifunctional, maleimide crosslinker for conjugation between sulfhydryl groups (-SH). Such bismaleimide crosslinkers are commonly used to explore and characterize protein structure (i.e., oligomerization) or protein interactions. DTME is similar in length to BMH but differs in containing a disulfide bond in its spacer arm, allowing crosslinks with DTME to be cleaved with reducing agent such as dithiothreitol (DTT). | | reaction suitability | reagent type: cross-linking reagent |
| | DITHIO-BIS-MALEIMIDOETHANE Preparation Products And Raw materials |
|