1,8-Bis-maleimidotriethyleneglycol manufacturers
- Mal-PEG2-Mal
-
-
2025-06-07
- CAS:115597-84-7
- Min. Order: 5g
- Purity: >98.00%
- Supply Ability: 5g
|
| | 1,8-Bis-maleimidotriethyleneglycol Basic information |
| Product Name: | 1,8-Bis-maleimidotriethyleneglycol | | Synonyms: | BM[PEO]3;2,2'-(ETHYLENEDIOXY)BIS(ETHYLMALEIMIDE);1,8-Bis-maleimido-(PEO)3;1H-Pyrrole-2,5-dione, 1,1'-[1,2-ethanediylbis(oxy-2,1-ethanediyl)]bis-;1,8-Bis(MaleiMido)-3,6-dioxaoctane;1,8-Bis-maleimidotetraethyleneglycol;BM(PEG)2;1,1'-(2,2'-(ethane-1,2-diylbis(oxy))bis(ethane-2,1-diyl))bis(1H-pyrrole-2,5-dione) | | CAS: | 115597-84-7 | | MF: | C14H16N2O6 | | MW: | 308.29 | | EINECS: | | | Product Categories: | pharmacetical;Maleimide Derivatives;Crosslinker;MTS & Sulfhydryl Active Reagents;Cross Linking Reagents | | Mol File: | 115597-84-7.mol |  |
| | 1,8-Bis-maleimidotriethyleneglycol Chemical Properties |
| Melting point | 99°C | | Boiling point | 499.2±35.0 °C(Predicted) | | density | 1.373±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | Solid | | pka | -2.04±0.20(Predicted) | | color | White to Off-White | | Water Solubility | water: soluble | | Cosmetics Ingredients Functions | SURFACE MODIFIER HAIR CONDITIONING OXIDISING HAIR WAVING OR STRAIGHTENING SKIN CONDITIONING - MISCELLANEOUS HAIR DYEING HAIR FIXING BINDING | | InChI | 1S/C14H16N2O6/c17-11-1-2-12(18)15(11)5-7-21-9-10-22-8-6-16-13(19)3-4-14(16)20/h1-4H,5-10H2 | | InChIKey | FERLGYOHRKHQJP-UHFFFAOYSA-N | | SMILES | O=C(C=CC1=O)N1CCOCCOCCN2C(C=CC2=O)=O |
| WGK Germany | WGK 3 | | HS Code | 2925.19.4200 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1,8-Bis-maleimidotriethyleneglycol Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | A sulfhydryl reactive homobifunctional reagent for polypeptide or small molecule conjugation | | reaction suitability | reagent type: cross-linking reagent |
| | 1,8-Bis-maleimidotriethyleneglycol Preparation Products And Raw materials |
|