|
|
| | 1-Boc-4-methanesulfonyloxymethyl-piperidine Basic information |
| Product Name: | 1-Boc-4-methanesulfonyloxymethyl-piperidine | | Synonyms: | TERT-BUTYL 4-([(METHYLSULFONYL)OXY]METHYL)TETRAHYDRO-1(2H)-PYRIDINECARBOXYLATE;1-N-BOC-4-METHANESULFONYLOXYMETHYLPIPERIDINE;1-piperidinecarboxylic acid, 4-[[(methylsulfonyl)oxy]methy;tert-butyl 4-{[(methylsulfonyl)oxy]methyl}piperidine-1-carboxylate;1-Boc-4-(MethylsulfonyloxyMethyl)piperidine;N-Boc-4-MethanesulfonyloxyMethyl-piperidine;tert-Butyl 4-MethylsulfonyloxyMethyl-1-piperidinecarboxylate;4-[[(Methylsulfonyl)oxy]methyl]piperidine-1-carboxylic acid tert-butyl ester | | CAS: | 161975-39-9 | | MF: | C12H23NO5S | | MW: | 293.38 | | EINECS: | | | Product Categories: | | | Mol File: | 161975-39-9.mol |  |
| | 1-Boc-4-methanesulfonyloxymethyl-piperidine Chemical Properties |
| Melting point | 73-76°C | | Boiling point | 418.8±18.0 °C(Predicted) | | density | 1.175±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | -1.96±0.40(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C12H23NO5S/c1-12(2,3)18-11(14)13-7-5-10(6-8-13)9-17-19(4,15)16/h10H,5-9H2,1-4H3 | | InChIKey | RXNQBVRCZIYUJK-UHFFFAOYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCC(COS(C)(=O)=O)CC1 |
| | 1-Boc-4-methanesulfonyloxymethyl-piperidine Usage And Synthesis |
| Uses | 1-Boc-4-methanesulfonyloxymethyl-piperidine can be used to synthesize antitumor, central nervous system drugs, GPCR ligands, and kinase inhibitors. |
| | 1-Boc-4-methanesulfonyloxymethyl-piperidine Preparation Products And Raw materials |
|